Difference between revisions of "E3-independent-Ubiquitin-E2-L-cysteine"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Ec-27_002040 == * left end position: ** 1742341 * transcription direction: ** NEGATIVE * right end position: ** 1749598 * centisome position: ** 27.0...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11527 CPD-11527] == * smiles: ** CCC=CCC4(C(=O)CCC(CC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)C...")
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Ec-27_002040 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11527 CPD-11527] ==
−
* left end position:
+
* smiles:
−
** 1742341
+
** CCC=CCC4(C(=O)CCC(CC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])4)
−
* transcription direction:
+
* inchi key:
−
** NEGATIVE
+
** InChIKey=YUFHOTSRMDFGNS-RWUAOFFVSA-J
−
* right end position:
+
* common name:
−
** 1749598
+
** OPC4-3-hydroxyacyl-CoA
−
* centisome position:
+
* molecular weight:
−
** 27.013428    
+
** 999.813    
 
* Synonym(s):
 
* Synonym(s):
−
** Esi_0036_0068
 
−
** Esi0036_0068
 
−
** PK
 
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* [[PROTEIN-KINASE-RXN]]
+
* [[RXN-10703]]
−
** esiliculosus_genome
+
== Reaction(s) known to produce the compound ==
−
***go-term
+
* [[RXN-10705]]
−
== Pathways associated ==
+
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
−
{{#set: left end position=1742341}}
+
* PUBCHEM:
−
{{#set: transcription direction=NEGATIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237301 44237301]
−
{{#set: right end position=1749598}}
+
{{#set: smiles=CCC=CCC4(C(=O)CCC(CC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])4)}}
−
{{#set: centisome position=27.013428   }}
+
{{#set: inchi key=InChIKey=YUFHOTSRMDFGNS-RWUAOFFVSA-J}}
−
{{#set: common name=Esi_0036_0068|Esi0036_0068|PK}}
+
{{#set: common name=OPC4-3-hydroxyacyl-CoA}}
−
{{#set: reaction associated=PROTEIN-KINASE-RXN}}
+
{{#set: molecular weight=999.813   }}
 +
{{#set: consumed by=RXN-10703}}
 +
{{#set: produced by=RXN-10705}}

Revision as of 13:52, 21 March 2018

Metabolite CPD-11527

  • smiles:
    • CCC=CCC4(C(=O)CCC(CC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])4)
  • inchi key:
    • InChIKey=YUFHOTSRMDFGNS-RWUAOFFVSA-J
  • common name:
    • OPC4-3-hydroxyacyl-CoA
  • molecular weight:
    • 999.813
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CCC=CCC4(C(=O)CCC(CC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])4)" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=E3-independent-Ubiquitin-E2-L-cysteine&oldid=22333"