Difference between revisions of "D-6-P-GLUCONO-DELTA-LACTONE"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Ec-14_000350 == * left end position: ** 281059 * transcription direction: ** NEGATIVE * right end position: ** 287129 * centisome position: ** 4.2841...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-696 CPD-696] == * smiles: ** CC(C)C(=C)CCC(C)[CH]3(CCC4(C)([CH]1(CC[CH]5(C(C)(C)C(O)CCC2(CC...")
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Ec-14_000350 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-696 CPD-696] ==
−
* left end position:
+
* smiles:
−
** 281059
+
** CC(C)C(=C)CCC(C)[CH]3(CCC4(C)([CH]1(CC[CH]5(C(C)(C)C(O)CCC2(CC12CCC(C)34)5))))
−
* transcription direction:
+
* inchi key:
−
** NEGATIVE
+
** InChIKey=BDHQMRXFDYJGII-XPNRYQHYSA-N
−
* right end position:
+
* common name:
−
** 287129
+
** 24-methylenecycloartanol
−
* centisome position:
+
* molecular weight:
−
** 4.2841563    
+
** 440.751    
 
* Synonym(s):
 
* Synonym(s):
−
** Esi_0029_0052
+
** 24(28)-methylenecycloartanol
−
** Esi0029_0052
+
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* [[4.2.2.10-RXN]]
+
== Reaction(s) known to produce the compound ==
−
** esiliculosus_genome
+
* [[RXN-4021]]
−
***automated-name-match
+
== Reaction(s) of unknown directionality ==
−
* [[RXN-14897]]
+
−
** esiliculosus_genome
+
−
***automated-name-match
+
−
== Pathways associated ==
+
−
* [[PWY-7243]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: left end position=281059}}
+
* PUBCHEM:
−
{{#set: transcription direction=NEGATIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658794 90658794]
−
{{#set: right end position=287129}}
+
* LIGAND-CPD:
−
{{#set: centisome position=4.2841563   }}
+
** [http://www.genome.jp/dbget-bin/www_bget?C08830 C08830]
−
{{#set: common name=Esi_0029_0052|Esi0029_0052}}
+
{{#set: smiles=CC(C)C(=C)CCC(C)[CH]3(CCC4(C)([CH]1(CC[CH]5(C(C)(C)C(O)CCC2(CC12CCC(C)34)5))))}}
−
{{#set: reaction associated=4.2.2.10-RXN|RXN-14897}}
+
{{#set: inchi key=InChIKey=BDHQMRXFDYJGII-XPNRYQHYSA-N}}
−
{{#set: pathway associated=PWY-7243}}
+
{{#set: common name=24-methylenecycloartanol}}
 +
{{#set: molecular weight=440.751   }}
 +
{{#set: common name=24(28)-methylenecycloartanol}}
 +
{{#set: produced by=RXN-4021}}

Revision as of 14:52, 21 March 2018

Metabolite CPD-696

  • smiles:
    • CC(C)C(=C)CCC(C)[CH]3(CCC4(C)([CH]1(CC[CH]5(C(C)(C)C(O)CCC2(CC12CCC(C)34)5))))
  • inchi key:
    • InChIKey=BDHQMRXFDYJGII-XPNRYQHYSA-N
  • common name:
    • 24-methylenecycloartanol
  • molecular weight:
    • 440.751
  • Synonym(s):
    • 24(28)-methylenecycloartanol

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)C(=C)CCC(C)[CH]3(CCC4(C)([CH]1(CC[CH]5(C(C)(C)C(O)CCC2(CC12CCC(C)34)5))))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=D-6-P-GLUCONO-DELTA-LACTONE&oldid=22398"