Difference between revisions of "Ec-19 000380"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-202 CPD-202] == * smiles: ** CC(CCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7922 RXN-7922] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/1....")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-202 CPD-202] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7922 RXN-7922] ==
−
* smiles:
+
* direction:
−
** CC(CCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])[CH]5(CC[CH]6([CH]7(C(O)C[CH]4(CC(O)CCC(C)4[CH](CC(O)C(C)56)7))))
+
** LEFT-TO-RIGHT
−
* inchi key:
+
* ec number:
−
** InChIKey=ZKWNOTQHFKYUNU-JGCIYWTLSA-J
+
** [http://enzyme.expasy.org/EC/1.14.11.9 EC-1.14.11.9]
−
* common name:
+
−
** choloyl-CoA
+
−
* molecular weight:
+
−
** 1154.064   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 3-α,7-α,12-α-trihydroxy-5-β-cholanoyl-CoA
 
−
** 3α,7α,12α-trihydroxy-5β-cholan-24-oyl-CoA
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[2.3.1.176-RXN]]
+
** 1 [[2-KETOGLUTARATE]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''+''' 1 [[CPD-7214]][c] '''=>''' 1 [[CARBON-DIOXIDE]][c] '''+''' 1 [[CPD-7087]][c] '''+''' 1 [[SUC]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 2-oxoglutarate[c] '''+''' 1 oxygen[c] '''+''' 1 (2S)-dihydrotricetin[c] '''=>''' 1 CO2[c] '''+''' 1 (+)-dihydromyricetin[c] '''+''' 1 succinate[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-19_002760]]
 +
** Source: [[orthology-aragem]]
 +
* Gene: [[Ec-08_003510]]
 +
** Source: [[orthology-aragem]]
 +
* Gene: [[Ec-19_002750]]
 +
** Source: [[orthology-aragem]]
 +
== Pathways  ==
 +
* [[PWY-5152]], leucodelphinidin biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5152 PWY-5152]
 +
** '''2''' reactions found over '''5''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-aragem]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
* LIGAND-RXN:
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657878 90657878]
+
** [http://www.genome.jp/dbget-bin/www_bget?R05039 R05039]
−
* CHEBI:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=15519 15519]
+
{{#set: ec number=EC-1.14.11.9}}
−
* LIGAND-CPD:
+
{{#set: gene associated=Ec-19_002760|Ec-08_003510|Ec-19_002750}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C01794 C01794]
+
{{#set: in pathway=PWY-5152}}
−
* HMDB : HMDB01374
+
{{#set: reconstruction category=orthology}}
−
{{#set: smiles=CC(CCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])[CH]5(CC[CH]6([CH]7(C(O)C[CH]4(CC(O)CCC(C)4[CH](CC(O)C(C)56)7))))}}
+
{{#set: reconstruction source=orthology-aragem}}
−
{{#set: inchi key=InChIKey=ZKWNOTQHFKYUNU-JGCIYWTLSA-J}}
+
{{#set: reconstruction tool=pantograph}}
−
{{#set: common name=choloyl-CoA}}
+
−
{{#set: molecular weight=1154.064    }}
+
−
{{#set: common name=3-α,7-α,12-α-trihydroxy-5-β-cholanoyl-CoA|3α,7α,12α-trihydroxy-5β-cholan-24-oyl-CoA}}
+
−
{{#set: produced by=2.3.1.176-RXN}}
+

Revision as of 13:52, 21 March 2018

Reaction RXN-7922

  • direction:
    • LEFT-TO-RIGHT
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-5152, leucodelphinidin biosynthesis: PWY-5152
    • 2 reactions found over 5 reactions in the full pathway

Reconstruction information

External links




Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-19_000380&oldid=22414"