Difference between revisions of "Charged-GLY-tRNAs"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-330 CPD-330] == * smiles: ** C(O)C(O)[CH]1(C(O)C(O)C(=O)O1) * inchi key: ** InChIKey=SXZYCX...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=2.4.2.38-RXN 2.4.2.38-RXN] == * direction: ** REVERSIBLE * common name: ** Glycosyltransferase AER6...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=2.4.2.38-RXN 2.4.2.38-RXN] == |
− | * | + | * direction: |
− | ** | + | ** REVERSIBLE |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** Glycosyltransferase AER61, uncharacterised |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/2.4.2.38 EC-2.4.2.38] |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | = | + | * With identifiers: |
− | * [[ | + | ** 1 [[UDP-D-XYLOSE]][c] '''+''' 1 [[2-2-N-linked-Glycan]][c] '''<=>''' 1 [[PROTON]][c] '''+''' 1 [[UDP]][c] '''+''' 1 [[N4-N-ACETYL-BETA-D-GLUCOSAMINYL-X]][c] |
− | == | + | * With common name(s): |
− | * [[ | + | ** 1 UDP-α-D-xylose[c] '''+''' 1 N4-{N-acetyl-β-D-glucosaminyl-(1,2)-α-D-mannosyl-(1,3)-[N-acetyl-β-D-glucosaminyl-(1,2)-α-D-mannosyl-(1,6)]-β-D-mannosyl-(1,4)-N-acetyl-β-D-glucosaminyl-(1,4)-N-acetyl-β-D-glucosaminyl}-protein-L-asparagine[c] '''<=>''' 1 H+[c] '''+''' 1 UDP[c] '''+''' 1 an N4-{N-acetyl-β-D-glucosaminyl-(1,2)-α-D-mannosyl-(1,3)-[N-acetyl-β-D-glucosaminyl-(1,2)-α-D-mannosyl-(1,6)]-[β-D-xylosyl-(1,2)]-β-D-mannosyl-(1,4)-N-acetyl-β-D-glucosaminyl-(1,4)-N-acetyl-β-D-glucosaminyl}-L-asparagine-[protein][c] |
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Ec-07_002290]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | == Pathways == | ||
+ | == Reconstruction information == | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=10612 10612] | |
− | + | * LIGAND-RXN: | |
− | + | ** [http://www.genome.jp/dbget-bin/www_bget?R06016 R06016] | |
− | + | {{#set: direction=REVERSIBLE}} | |
− | + | {{#set: common name=Glycosyltransferase AER61, uncharacterised}} | |
− | ** [http://www.ebi.ac.uk/ | + | {{#set: ec number=EC-2.4.2.38}} |
− | * LIGAND- | + | {{#set: gene associated=Ec-07_002290}} |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | {{#set: in pathway=}} |
− | {{#set: | + | {{#set: reconstruction category=annotation}} |
− | {{#set: | + | {{#set: reconstruction source=annotation-esiliculosus_genome}} |
− | {{#set: | + | {{#set: reconstruction tool=pathwaytools}} |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 13:52, 21 March 2018
Contents
Reaction 2.4.2.38-RXN
- direction:
- REVERSIBLE
- common name:
- Glycosyltransferase AER61, uncharacterised
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 UDP-D-XYLOSE[c] + 1 2-2-N-linked-Glycan[c] <=> 1 PROTON[c] + 1 UDP[c] + 1 N4-N-ACETYL-BETA-D-GLUCOSAMINYL-X[c]
- With common name(s):
- 1 UDP-α-D-xylose[c] + 1 N4-{N-acetyl-β-D-glucosaminyl-(1,2)-α-D-mannosyl-(1,3)-[N-acetyl-β-D-glucosaminyl-(1,2)-α-D-mannosyl-(1,6)]-β-D-mannosyl-(1,4)-N-acetyl-β-D-glucosaminyl-(1,4)-N-acetyl-β-D-glucosaminyl}-protein-L-asparagine[c] <=> 1 H+[c] + 1 UDP[c] + 1 an N4-{N-acetyl-β-D-glucosaminyl-(1,2)-α-D-mannosyl-(1,3)-[N-acetyl-β-D-glucosaminyl-(1,2)-α-D-mannosyl-(1,6)]-[β-D-xylosyl-(1,2)]-β-D-mannosyl-(1,4)-N-acetyl-β-D-glucosaminyl-(1,4)-N-acetyl-β-D-glucosaminyl}-L-asparagine-[protein][c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Ec-07_002290
- Source: annotation-esiliculosus_genome
- Assignment: EC-NUMBER
- Source: annotation-esiliculosus_genome
Pathways
Reconstruction information
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome
External links