Difference between revisions of "CPD-3762"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-07_000620 == * left end position: ** 568258 * transcription direction: ** POSITIVE * right end position: ** 575874 * centisome position: ** 7.3585...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-330 CPD-330] == * smiles: ** C(O)C(O)[CH]1(C(O)C(O)C(=O)O1) * inchi key: ** InChIKey=SXZYCX...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-330 CPD-330] == |
− | * | + | * smiles: |
− | ** | + | ** C(O)C(O)[CH]1(C(O)C(O)C(=O)O1) |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=SXZYCXMUPBBULW-NEEWWZBLSA-N |
− | * | + | * common name: |
− | ** | + | ** L-galactono-1,4-lactone |
− | * | + | * molecular weight: |
− | ** | + | ** 178.141 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** L-galactono-γ-lactone |
− | ** | + | ** L-galactonate-γ-lactone |
+ | ** L-galactonic acid-γ-lactone | ||
+ | ** L-galactonic acid-g-lactone | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | == Reaction(s) known to produce the compound == |
− | + | * [[RXN-1884]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | * [[RXN- | + | * [[RXN-11152]] |
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * CAS : 1668-08-2 |
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6857365 6857365] |
− | {{#set: | + | * CHEMSPIDER: |
− | {{#set: common name= | + | ** [http://www.chemspider.com/Chemical-Structure.388522.html 388522] |
− | {{#set: reaction associated= | + | * CHEBI: |
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17464 17464] | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C01115 C01115] | ||
+ | {{#set: smiles=C(O)C(O)[CH]1(C(O)C(O)C(=O)O1)}} | ||
+ | {{#set: inchi key=InChIKey=SXZYCXMUPBBULW-NEEWWZBLSA-N}} | ||
+ | {{#set: common name=L-galactono-1,4-lactone}} | ||
+ | {{#set: molecular weight=178.141 }} | ||
+ | {{#set: common name=L-galactono-γ-lactone|L-galactonate-γ-lactone|L-galactonic acid-γ-lactone|L-galactonic acid-g-lactone}} | ||
+ | {{#set: produced by=RXN-1884}} | ||
+ | {{#set: reversible reaction associated=RXN-11152}} |
Revision as of 13:52, 21 March 2018
Contents
Metabolite CPD-330
- smiles:
- C(O)C(O)[CH]1(C(O)C(O)C(=O)O1)
- inchi key:
- InChIKey=SXZYCXMUPBBULW-NEEWWZBLSA-N
- common name:
- L-galactono-1,4-lactone
- molecular weight:
- 178.141
- Synonym(s):
- L-galactono-γ-lactone
- L-galactonate-γ-lactone
- L-galactonic acid-γ-lactone
- L-galactonic acid-g-lactone
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(O)C(O)[CH]1(C(O)C(O)C(=O)O1)" cannot be used as a page name in this wiki.