Difference between revisions of "MANNITOL-1P"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-137 CPD1F-137] == * smiles: ** C=C1(C3(CC4(C1)(C([CH]5(C2(C(=O)OC(CCC(O)2)([CH](CC3)4)5)(...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Stearoyl-ACPs Stearoyl-ACPs] == * common name: ** a stearoyl-[acp] * Synonym(s): ** octadecanyl...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-137 CPD1F-137] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Stearoyl-ACPs Stearoyl-ACPs] ==
* smiles:
+
** C=C1(C3(CC4(C1)(C([CH]5(C2(C(=O)OC(CCC(O)2)([CH](CC3)4)5)(C)))C([O-])=O)))
+
* inchi key:
+
** InChIKey=RSQSQJNRHICNNH-UKJRIFTCSA-M
+
 
* common name:
 
* common name:
** gibberellin A4
+
** a stearoyl-[acp]
* molecular weight:
+
** 331.388   
+
 
* Synonym(s):
 
* Synonym(s):
** GA4
+
** octadecanyl-[acp]
 +
** a stearoyl-[acyl-carrier-protein]
 +
** an octadecanoyl-[acp]
 +
** 18:0-ACP
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-6550]]
+
* [[RXN-16076]]
 +
* [[RXN-16024]]
 +
* [[RXN1G-368]]
 +
* [[RXN-9548]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN1F-165]]
+
* [[RXN-9635]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
* DRUGBANK : DB07815
+
{{#set: common name=a stearoyl-[acp]}}
* LIPID_MAPS : LMPR0104170021
+
{{#set: common name=octadecanyl-[acp]|a stearoyl-[acyl-carrier-protein]|an octadecanoyl-[acp]|18:0-ACP}}
* PUBCHEM:
+
{{#set: consumed by=RXN-16076|RXN-16024|RXN1G-368|RXN-9548}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245706 25245706]
+
{{#set: produced by=RXN-9635}}
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C11864 C11864]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=32902 32902]
+
* METABOLIGHTS : MTBLC32902
+
{{#set: smiles=C=C1(C3(CC4(C1)(C([CH]5(C2(C(=O)OC(CCC(O)2)([CH](CC3)4)5)(C)))C([O-])=O)))}}
+
{{#set: inchi key=InChIKey=RSQSQJNRHICNNH-UKJRIFTCSA-M}}
+
{{#set: common name=gibberellin A4}}
+
{{#set: molecular weight=331.388    }}
+
{{#set: common name=GA4}}
+
{{#set: consumed by=RXN-6550}}
+
{{#set: produced by=RXN1F-165}}
+

Revision as of 14:53, 21 March 2018

Metabolite Stearoyl-ACPs

  • common name:
    • a stearoyl-[acp]
  • Synonym(s):
    • octadecanyl-[acp]
    • a stearoyl-[acyl-carrier-protein]
    • an octadecanoyl-[acp]
    • 18:0-ACP

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"a stearoyl-[acp" cannot be used as a page name in this wiki.
  • "octadecanyl-[acp" cannot be used as a page name in this wiki.
  • "a stearoyl-[acyl-carrier-protein" cannot be used as a page name in this wiki.
  • "an octadecanoyl-[acp" cannot be used as a page name in this wiki.