Difference between revisions of "CPD-13174"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-HYDROXYADIPYL-COA 3-HYDROXYADIPYL-COA] == * smiles: ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(CC(CCC(=O...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9660 RXN-9660] == * direction: ** LEFT-TO-RIGHT * common name: ** trans-Δ2-decenoyl-[acp]...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-HYDROXYADIPYL-COA 3-HYDROXYADIPYL-COA] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9660 RXN-9660] ==
* smiles:
+
* direction:
** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(CC(CCC(=O)[O-])O)=O)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=OTEACGAEDCIMBS-NOTSHUFBSA-I
+
 
* common name:
 
* common name:
** (3S)-hydroxyadipyl-CoA
+
** trans-Δ2-decenoyl-[acp]-reductase
* molecular weight:
+
** Glucose/ribitol dehydrogenase
** 906.621   
+
* ec number:
 +
** [http://enzyme.expasy.org/EC/1.3.1.9 EC-1.3.1.9]
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
== Reaction(s) known to produce the compound ==
+
* With identifiers:
== Reaction(s) of unknown directionality ==
+
** 1 [[Trans-D2-decenoyl-ACPs]][c] '''+''' 1 [[NADH]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[NAD]][c] '''+''' 1 [[Decanoyl-ACPs]][c]
* [[RXN-2425]]
+
* With common name(s):
* [[RXN0-2044]]
+
** 1 a (2E)-dec-2-enoyl-[acp][c] '''+''' 1 NADH[c] '''+''' 1 H+[c] '''=>''' 1 NAD+[c] '''+''' 1 a decanoyl-[acp][c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-27_002470]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
* [[PWY-5971]], palmitate biosynthesis II (bacteria and plants): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5971 PWY-5971]
 +
** '''28''' reactions found over '''31''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=70679061 70679061]
+
{{#set: common name=trans-Δ2-decenoyl-[acp]-reductase}}
* CHEBI:
+
{{#set: common name=Glucose/ribitol dehydrogenase}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=70990 70990]
+
{{#set: ec number=EC-1.3.1.9}}
* LIGAND-CPD:
+
{{#set: gene associated=Ec-27_002470}}
** [http://www.genome.jp/dbget-bin/www_bget?C14145 C14145]
+
{{#set: in pathway=PWY-5971}}
* HMDB : HMDB12475
+
{{#set: reconstruction category=annotation}}
{{#set: smiles=CC(C)(C(O)C(=O)NCCC(=O)NCCSC(CC(CCC(=O)[O-])O)=O)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
{{#set: inchi key=InChIKey=OTEACGAEDCIMBS-NOTSHUFBSA-I}}
+
{{#set: reconstruction tool=pathwaytools}}
{{#set: common name=(3S)-hydroxyadipyl-CoA}}
+
{{#set: molecular weight=906.621    }}
+
{{#set: reversible reaction associated=RXN-2425|RXN0-2044}}
+

Revision as of 13:53, 21 March 2018

Reaction RXN-9660

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • trans-Δ2-decenoyl-[acp]-reductase
    • Glucose/ribitol dehydrogenase
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-5971, palmitate biosynthesis II (bacteria and plants): PWY-5971
    • 28 reactions found over 31 reactions in the full pathway

Reconstruction information

External links

"trans-Δ2-decenoyl-[acp]-reductase" cannot be used as a page name in this wiki.