Difference between revisions of "RXN-13443"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=RETINAL RETINAL] == * smiles: ** CC(C=CC1(C(C)(C)CCCC(C)=1))=CC=CC(C)=C[CH]=O * inchi key: ** I...") |
(Created page with "Category:Gene == Gene Ec-02_004150 == * left end position: ** 4451715 * transcription direction: ** POSITIVE * right end position: ** 4465763 * centisome position: ** 68.1...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-02_004150 == |
− | * | + | * left end position: |
− | ** | + | ** 4451715 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 4465763 |
− | * | + | * centisome position: |
− | ** | + | ** 68.19634 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0041_0160 |
− | ** | + | ** Esi0041_0160 |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[ATPASE-RXN]] | |
− | + | ** Source: [[annotation-esiliculosus_genome]] | |
− | * [[ | + | *** Assignment: go-term |
+ | == Pathways associated == | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=4451715}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=4465763}} | |
− | + | {{#set: centisome position=68.19634 }} | |
− | + | {{#set: common name=Esi_0041_0160|Esi0041_0160}} | |
− | + | {{#set: reaction associated=ATPASE-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + |
Revision as of 13:53, 21 March 2018
Gene Ec-02_004150
- left end position:
- 4451715
- transcription direction:
- POSITIVE
- right end position:
- 4465763
- centisome position:
- 68.19634
- Synonym(s):
- Esi_0041_0160
- Esi0041_0160
Reactions associated
- Reaction: ATPASE-RXN
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome