Difference between revisions of "CPD-9007"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HOMO-I-CIT HOMO-I-CIT] == * smiles: ** C(CC(=O)[O-])C(C(=O)[O-])C(O)C(=O)[O-] * inchi key: ** I...") |
(Created page with "Category:Gene == Gene Ec-10_001650 == * left end position: ** 1667734 * transcription direction: ** NEGATIVE * right end position: ** 1676505 * centisome position: ** 25.6...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-10_001650 == |
− | * | + | * left end position: |
− | ** | + | ** 1667734 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 1676505 |
− | * | + | * centisome position: |
− | ** | + | ** 25.653559 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0168_0075 |
− | ** | + | ** Esi0168_0075 |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[RXN-8281]] | |
− | * [[ | + | ** Source: [[annotation-esiliculosus_genome]] |
− | == | + | *** Assignment: automated-name-match |
− | * [[ | + | == Pathways associated == |
+ | * [[PWY-5338]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=1667734}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=1676505}} | |
− | + | {{#set: centisome position=25.653559 }} | |
− | + | {{#set: common name=Esi_0168_0075|Esi0168_0075}} | |
− | + | {{#set: reaction associated=RXN-8281}} | |
− | + | {{#set: pathway associated=PWY-5338}} | |
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 13:54, 21 March 2018
Gene Ec-10_001650
- left end position:
- 1667734
- transcription direction:
- NEGATIVE
- right end position:
- 1676505
- centisome position:
- 25.653559
- Synonym(s):
- Esi_0168_0075
- Esi0168_0075
Reactions associated
- Reaction: RXN-8281
- Source: annotation-esiliculosus_genome
- Assignment: automated-name-match
- Source: annotation-esiliculosus_genome