Difference between revisions of "RXN-8028"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3Z-PHYTOCHROMOBILIN 3Z-PHYTOCHROMOBILIN] == * smiles: ** CC=C1(C(C)C(NC1=CC4(=C(C)C(CCC([O-])=O...")
(Created page with "Category:Gene == Gene Ec-25_000800 == * Synonym(s): ** Esi_0265_0053 ** Esi0265_0053 == Reactions associated == * Reaction: RXN-8443 ** Source: orthology-aragem =...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3Z-PHYTOCHROMOBILIN 3Z-PHYTOCHROMOBILIN] ==
+
== Gene Ec-25_000800 ==
* smiles:
+
** CC=C1(C(C)C(NC1=CC4(=C(C)C(CCC([O-])=O)=C(C=C2(C(CCC([O-])=O)=C(C)C(=N2)C=C3(C(C)=C(C=C)C(=O)N3)))N4))=O)
+
* inchi key:
+
** InChIKey=DKMLMZVDTGOEGU-AIKFXVFZSA-L
+
* common name:
+
** (3Z)-phytochromobilin
+
* molecular weight:
+
** 582.655   
+
 
* Synonym(s):
 
* Synonym(s):
 +
** Esi_0265_0053
 +
** Esi0265_0053
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
== Reaction(s) known to produce the compound ==
+
* Reaction: [[RXN-8443]]
* [[1.3.7.4-RXN]]
+
** Source: [[orthology-aragem]]
== Reaction(s) of unknown directionality ==
+
== Pathways associated ==
 +
* [[PWY-5381]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=Esi_0265_0053|Esi0265_0053}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25246013 25246013]
+
{{#set: reaction associated=RXN-8443}}
{{#set: smiles=CC=C1(C(C)C(NC1=CC4(=C(C)C(CCC([O-])=O)=C(C=C2(C(CCC([O-])=O)=C(C)C(=N2)C=C3(C(C)=C(C=C)C(=O)N3)))N4))=O)}}
+
{{#set: pathway associated=PWY-5381}}
{{#set: inchi key=InChIKey=DKMLMZVDTGOEGU-AIKFXVFZSA-L}}
+
{{#set: common name=(3Z)-phytochromobilin}}
+
{{#set: molecular weight=582.655    }}
+
{{#set: produced by=1.3.7.4-RXN}}
+

Revision as of 14:55, 21 March 2018

Gene Ec-25_000800

  • Synonym(s):
    • Esi_0265_0053
    • Esi0265_0053

Reactions associated

Pathways associated

External links