Difference between revisions of "CPD0-1422"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11521 CPD-11521] == * smiles: ** CCC=CCC4(C(=O)CCC(CCCCCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14280 RXN-14280] == * direction: ** REVERSIBLE * common name: ** perillyl aldehyde dehydrogenas...")
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11521 CPD-11521] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14280 RXN-14280] ==
* smiles:
+
* direction:
** CCC=CCC4(C(=O)CCC(CCCCCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)4)
+
** REVERSIBLE
* inchi key:
+
** InChIKey=VWFUYQVGVAEVNH-CNALLRBTSA-J
+
 
* common name:
 
* common name:
** OPC6-CoA
+
** perillyl aldehyde dehydrogenase
* molecular weight:
+
* ec number:
** 1011.867   
+
** [http://enzyme.expasy.org/EC/1.2.1.3 EC-1.2.1.3]
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[RXN-10706]]
+
* With identifiers:
== Reaction(s) known to produce the compound ==
+
** 1 [[NAD]][c] '''+''' 1 [[WATER]][c] '''+''' 1 [[CPD-1084]][c] '''<=>''' 1 [[NADH]][c] '''+''' 1 [[CPD-12443]][c] '''+''' 2 [[PROTON]][c]
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 NAD+[c] '''+''' 1 H2O[c] '''+''' 1 perillyl aldehyde[c] '''<=>''' 1 NADH[c] '''+''' 1 perillate[c] '''+''' 2 H+[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-11_002450]]
 +
** Source: [[orthology-aragem]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-aragem]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
* RHEA:
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237133 44237133]
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=31302 31302]
{{#set: smiles=CCC=CCC4(C(=O)CCC(CCCCCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)4)}}
+
* LIGAND-RXN:
{{#set: inchi key=InChIKey=VWFUYQVGVAEVNH-CNALLRBTSA-J}}
+
** [http://www.genome.jp/dbget-bin/www_bget?R06366 R06366]
{{#set: common name=OPC6-CoA}}
+
{{#set: direction=REVERSIBLE}}
{{#set: molecular weight=1011.867    }}
+
{{#set: common name=perillyl aldehyde dehydrogenase}}
{{#set: consumed by=RXN-10706}}
+
{{#set: ec number=EC-1.2.1.3}}
 +
{{#set: gene associated=Ec-11_002450}}
 +
{{#set: in pathway=}}
 +
{{#set: reconstruction category=orthology}}
 +
{{#set: reconstruction source=orthology-aragem}}
 +
{{#set: reconstruction tool=pantograph}}

Revision as of 14:56, 21 March 2018

Reaction RXN-14280

  • direction:
    • REVERSIBLE
  • common name:
    • perillyl aldehyde dehydrogenase
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 NAD+[c] + 1 H2O[c] + 1 perillyl aldehyde[c] <=> 1 NADH[c] + 1 perillate[c] + 2 H+[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links