Difference between revisions of "RXN1G-445"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=AN-ALPHA-L-FUCOSIDE AN-ALPHA-L-FUCOSIDE] == * smiles: ** CC1(OC(O[R])C(O)C(O)C(O)1) * common na...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14476 RXN-14476] == * direction: ** REVERSIBLE * ec number: ** [http://enzyme.expasy.org/EC/1.3...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14476 RXN-14476] == |
| − | * | + | * direction: |
| − | ** | + | ** REVERSIBLE |
| − | * | + | * ec number: |
| − | ** | + | ** [http://enzyme.expasy.org/EC/1.3.1.79 EC-1.3.1.79] |
* Synonym(s): | * Synonym(s): | ||
| − | == Reaction | + | == Reaction Formula == |
| − | * [[ | + | * With identifiers: |
| − | = | + | ** 1 [[NAD-P-OR-NOP]][c] '''+''' 1 [[CPD-659]][c] '''<=>''' 1 [[NADH-P-OR-NOP]][c] '''+''' 1 [[TYR]][c] '''+''' 1 [[CARBON-DIOXIDE]][c] |
| − | == | + | * With common name(s): |
| + | ** 1 NAD(P)+[c] '''+''' 1 L-arogenate[c] '''<=>''' 1 NAD(P)H[c] '''+''' 1 L-tyrosine[c] '''+''' 1 CO2[c] | ||
| + | |||
| + | == Genes associated with this reaction == | ||
| + | == Pathways == | ||
| + | == Reconstruction information == | ||
| + | * Category: [[gap-filling]] | ||
| + | ** Source: [[gap-filling-gapfilling_solution_with_meneco_draft_medium]] | ||
| + | *** Tool: [[meneco]] | ||
| + | **** Comment: [[added for gapfilling]] | ||
== External links == | == External links == | ||
| − | + | {{#set: direction=REVERSIBLE}} | |
| − | + | {{#set: ec number=EC-1.3.1.79}} | |
| − | + | {{#set: in pathway=}} | |
| − | + | {{#set: reconstruction category=gap-filling}} | |
| − | {{#set: | + | {{#set: reconstruction source=gap-filling-gapfilling_solution_with_meneco_draft_medium}} |
| − | {{#set: | + | {{#set: reconstruction tool=meneco}} |
| − | {{#set: | + | {{#set: reconstruction comment=added for gapfilling}} |
Revision as of 14:56, 21 March 2018
Contents
Reaction RXN-14476
- direction:
- REVERSIBLE
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 NAD-P-OR-NOP[c] + 1 CPD-659[c] <=> 1 NADH-P-OR-NOP[c] + 1 TYR[c] + 1 CARBON-DIOXIDE[c]
- With common name(s):
- 1 NAD(P)+[c] + 1 L-arogenate[c] <=> 1 NAD(P)H[c] + 1 L-tyrosine[c] + 1 CO2[c]
Genes associated with this reaction
Pathways
Reconstruction information
- Category: gap-filling
- Source: gap-filling-gapfilling_solution_with_meneco_draft_medium
- Tool: meneco
- Comment: added for gapfilling
- Tool: meneco
- Source: gap-filling-gapfilling_solution_with_meneco_draft_medium
