Difference between revisions of "Ec-16 002500"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-477 RXN66-477] == * direction: ** LEFT-TO-RIGHT * common name: ** straight chain fatty acyl-C...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14407 CPD-14407] == * smiles: ** CCCCCC=CCC=CCC=CCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14407 CPD-14407] == |
− | * | + | * smiles: |
− | ** | + | ** CCCCCC=CCC=CCC=CCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] |
+ | * inchi key: | ||
+ | ** InChIKey=FJWJALRUNNZIBB-DDQUOPDJSA-J | ||
* common name: | * common name: | ||
− | ** | + | ** dihomo γ-linolenoyl-CoA |
− | + | * molecular weight: | |
− | + | ** 1051.975 | |
− | * | + | |
− | ** | + | |
* Synonym(s): | * Synonym(s): | ||
+ | ** (8Z,11Z,14Z)-icosatrienoyl-CoA | ||
+ | ** (8Z,11Z,14Z)-icosa-8,11,14-trienoyl-CoA | ||
+ | ** (8Z,11Z,14Z)-eicosa-8,11,14-trienoyl-CoA | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | * [[RXN-16044]] | |
− | + | * [[RXN-13435]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RXN-17105]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | = | + | |
− | + | ||
− | * [[ | + | |
− | + | ||
− | + | ||
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | * [[ | + | |
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | + | * PUBCHEM: | |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=71581179 71581179] |
− | {{#set: | + | * CHEBI: |
− | {{#set: common name= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=74264 74264] |
− | {{#set: | + | {{#set: smiles=CCCCCC=CCC=CCC=CCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} |
− | {{#set: | + | {{#set: inchi key=InChIKey=FJWJALRUNNZIBB-DDQUOPDJSA-J}} |
− | + | {{#set: common name=dihomo γ-linolenoyl-CoA}} | |
− | {{#set: | + | {{#set: molecular weight=1051.975 }} |
− | + | {{#set: common name=(8Z,11Z,14Z)-icosatrienoyl-CoA|(8Z,11Z,14Z)-icosa-8,11,14-trienoyl-CoA|(8Z,11Z,14Z)-eicosa-8,11,14-trienoyl-CoA}} | |
− | {{#set: | + | {{#set: consumed by=RXN-16044|RXN-13435}} |
+ | {{#set: produced by=RXN-17105}} |
Revision as of 14:57, 21 March 2018
Contents
Metabolite CPD-14407
- smiles:
- CCCCCC=CCC=CCC=CCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
- inchi key:
- InChIKey=FJWJALRUNNZIBB-DDQUOPDJSA-J
- common name:
- dihomo γ-linolenoyl-CoA
- molecular weight:
- 1051.975
- Synonym(s):
- (8Z,11Z,14Z)-icosatrienoyl-CoA
- (8Z,11Z,14Z)-icosa-8,11,14-trienoyl-CoA
- (8Z,11Z,14Z)-eicosa-8,11,14-trienoyl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCCCCC=CCC=CCC=CCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.