Difference between revisions of "CPD-497"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Saturated-2-Lysophosphatidates Saturated-2-Lysophosphatidates] == * common name: ** a 2,3,4-sat...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIMP DIMP] == * smiles: ** C(OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C=NC2(C(=O)NC=NC=23))) * inchi ke...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIMP DIMP] == |
+ | * smiles: | ||
+ | ** C(OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C=NC2(C(=O)NC=NC=23))) | ||
+ | * inchi key: | ||
+ | ** InChIKey=PHNGFPPXDJJADG-RRKCRQDMSA-L | ||
* common name: | * common name: | ||
− | ** | + | ** dIMP |
+ | * molecular weight: | ||
+ | ** 330.193 | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** 2'-deoxy-IMP |
− | ** | + | ** 2'-deoxy-5'-inosinic acid |
− | ** | + | ** 2'-Deoxyinosine 5'-monophosphate |
− | ** | + | ** 2'-Deoxyinosine 5'-phosphate |
− | ** | + | ** 9-(2-deoxy-5-O-phosphono-β-D-erythro-pentofuranosyl)-9H-purin-6-ol |
− | + | ** Deoxyinosine monophosphate | |
− | + | ** Hypoxanthine deoxyriboside | |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN0-1602]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | {{#set: | + | * BIGG : 47635 |
− | {{#set: common name= | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=22841129 22841129] |
+ | * HMDB : HMDB06555 | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C06196 C06196] | ||
+ | * CHEMSPIDER: | ||
+ | ** [http://www.chemspider.com/Chemical-Structure.18596798.html 18596798] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61194 61194] | ||
+ | * METABOLIGHTS : MTBLC61194 | ||
+ | {{#set: smiles=C(OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C=NC2(C(=O)NC=NC=23)))}} | ||
+ | {{#set: inchi key=InChIKey=PHNGFPPXDJJADG-RRKCRQDMSA-L}} | ||
+ | {{#set: common name=dIMP}} | ||
+ | {{#set: molecular weight=330.193 }} | ||
+ | {{#set: common name=2'-deoxy-IMP|2'-deoxy-5'-inosinic acid|2'-Deoxyinosine 5'-monophosphate|2'-Deoxyinosine 5'-phosphate|9-(2-deoxy-5-O-phosphono-β-D-erythro-pentofuranosyl)-9H-purin-6-ol|Deoxyinosine monophosphate|Hypoxanthine deoxyriboside}} | ||
+ | {{#set: produced by=RXN0-1602}} |
Revision as of 14:58, 21 March 2018
Contents
Metabolite DIMP
- smiles:
- C(OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C=NC2(C(=O)NC=NC=23)))
- inchi key:
- InChIKey=PHNGFPPXDJJADG-RRKCRQDMSA-L
- common name:
- dIMP
- molecular weight:
- 330.193
- Synonym(s):
- 2'-deoxy-IMP
- 2'-deoxy-5'-inosinic acid
- 2'-Deoxyinosine 5'-monophosphate
- 2'-Deoxyinosine 5'-phosphate
- 9-(2-deoxy-5-O-phosphono-β-D-erythro-pentofuranosyl)-9H-purin-6-ol
- Deoxyinosine monophosphate
- Hypoxanthine deoxyriboside
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- BIGG : 47635
- PUBCHEM:
- HMDB : HMDB06555
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- METABOLIGHTS : MTBLC61194
"C(OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C=NC2(C(=O)NC=NC=23)))" cannot be used as a page name in this wiki.