Difference between revisions of "Poly-Gamma-Glutamylcysteine-Glycines"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=tRNA-Containing-5AminoMe-2-ThioUrdines tRNA-Containing-5AminoMe-2-ThioUrdines] == * common name...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-380 CPD-380] == * smiles: ** C(=O)([O-])C(=O)CS(=O)(=O)[O-] * inchi key: ** InChIKey=BUTHMS...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-380 CPD-380] == |
| + | * smiles: | ||
| + | ** C(=O)([O-])C(=O)CS(=O)(=O)[O-] | ||
| + | * inchi key: | ||
| + | ** InChIKey=BUTHMSUEBYPMKJ-UHFFFAOYSA-L | ||
* common name: | * common name: | ||
| − | ** | + | ** 3-sulfopyruvate |
| + | * molecular weight: | ||
| + | ** 166.105 | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** sulfopyruvate |
| + | ** 3-Sulfopyruvic acid | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| + | * [[RXN-11737]] | ||
== External links == | == External links == | ||
| − | {{#set: | + | * LIGAND-CPD: |
| − | {{#set: common name= | + | ** [http://www.genome.jp/dbget-bin/www_bget?C05528 C05528] |
| − | {{#set: | + | * CHEBI: |
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57940 57940] | ||
| + | * METABOLIGHTS : MTBLC57940 | ||
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245217 25245217] | ||
| + | * HMDB : HMDB04045 | ||
| + | {{#set: smiles=C(=O)([O-])C(=O)CS(=O)(=O)[O-]}} | ||
| + | {{#set: inchi key=InChIKey=BUTHMSUEBYPMKJ-UHFFFAOYSA-L}} | ||
| + | {{#set: common name=3-sulfopyruvate}} | ||
| + | {{#set: molecular weight=166.105 }} | ||
| + | {{#set: common name=sulfopyruvate|3-Sulfopyruvic acid}} | ||
| + | {{#set: reversible reaction associated=RXN-11737}} | ||
Revision as of 13:58, 21 March 2018
Contents
Metabolite CPD-380
- smiles:
- C(=O)([O-])C(=O)CS(=O)(=O)[O-]
- inchi key:
- InChIKey=BUTHMSUEBYPMKJ-UHFFFAOYSA-L
- common name:
- 3-sulfopyruvate
- molecular weight:
- 166.105
- Synonym(s):
- sulfopyruvate
- 3-Sulfopyruvic acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(=O)([O-])C(=O)CS(=O)(=O)[O-" cannot be used as a page name in this wiki.
