Difference between revisions of "CPD-2750"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-5S-5-AMINO-5-CARBOXYPENTANOYL-L-CY N-5S-5-AMINO-5-CARBOXYPENTANOYL-L-CY] == * smiles: ** CC(C...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Cytochromes-c Cytochromes-c] == * common name: ** a c-type cytochrome * Synonym(s): ** a cytoch...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-5S-5-AMINO-5-CARBOXYPENTANOYL-L-CY N-5S-5-AMINO-5-CARBOXYPENTANOYL-L-CY] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Cytochromes-c Cytochromes-c] ==
−
* smiles:
+
−
** CC(C)C(NC(=O)C(NC(=O)CCCC([N+])C(=O)[O-])CS)C(=O)[O-]
+
−
* inchi key:
+
−
** InChIKey=BYEIJZFKOAXBBV-QXEWZRGKSA-M
+
 
* common name:
 
* common name:
−
** N-[(5S)-5-amino-5-carboxypentanoyl]-L-cysteinyl-D-valine
+
** a c-type cytochrome
−
* molecular weight:
+
−
** 362.42   
+
 
* Synonym(s):
 
* Synonym(s):
−
** ACV
+
** a cytochrome C protein
−
** L-δ-(α-aminoadipoyl)-L-cysteinyl-D-valine
+
** a cytochrome c
−
** δ(L-2-aminoadipyl)-L-cysteinyl-D-valine
+
−
** N-[L-5-amino-5-carboxypentanoyl]-L-cysteinyl-D-valine
+
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[1.21.3.1-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 +
* [[HOLOCYTOCHROME-C-SYNTHASE-RXN]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: common name=a c-type cytochrome}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91820470 91820470]
+
{{#set: common name=a cytochrome C protein|a cytochrome c}}
−
* CHEBI:
+
{{#set: reversible reaction associated=HOLOCYTOCHROME-C-SYNTHASE-RXN}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58572 58572]
+
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C05556 C05556]
+
−
{{#set: smiles=CC(C)C(NC(=O)C(NC(=O)CCCC([N+])C(=O)[O-])CS)C(=O)[O-]}}
+
−
{{#set: inchi key=InChIKey=BYEIJZFKOAXBBV-QXEWZRGKSA-M}}
+
−
{{#set: common name=N-[(5S)-5-amino-5-carboxypentanoyl]-L-cysteinyl-D-valine}}
+
−
{{#set: molecular weight=362.42    }}
+
−
{{#set: common name=ACV|L-δ-(α-aminoadipoyl)-L-cysteinyl-D-valine|δ(L-2-aminoadipyl)-L-cysteinyl-D-valine|N-[L-5-amino-5-carboxypentanoyl]-L-cysteinyl-D-valine}}
+
−
{{#set: consumed by=1.21.3.1-RXN}}
+

Revision as of 13:58, 21 March 2018

Metabolite Cytochromes-c

  • common name:
    • a c-type cytochrome
  • Synonym(s):
    • a cytochrome C protein
    • a cytochrome c

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=CPD-2750&oldid=23262"