Difference between revisions of "CPD-17313"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-DEOXYRIBOSE 2-DEOXYRIBOSE] == * smiles: ** C(O)C(O)C(O)CC=O * inchi key: ** InChIKey=ASJSAQIR...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-5S-5-AMINO-5-CARBOXYPENTANOYL-L-CY N-5S-5-AMINO-5-CARBOXYPENTANOYL-L-CY] == * smiles: ** CC(C...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-5S-5-AMINO-5-CARBOXYPENTANOYL-L-CY N-5S-5-AMINO-5-CARBOXYPENTANOYL-L-CY] == |
* smiles: | * smiles: | ||
| − | ** C(O)C(O)C(O) | + | ** CC(C)C(NC(=O)C(NC(=O)CCCC([N+])C(=O)[O-])CS)C(=O)[O-] |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=BYEIJZFKOAXBBV-QXEWZRGKSA-M |
* common name: | * common name: | ||
| − | ** | + | ** N-[(5S)-5-amino-5-carboxypentanoyl]-L-cysteinyl-D-valine |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 362.42 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** ACV |
| − | ** | + | ** L-δ-(α-aminoadipoyl)-L-cysteinyl-D-valine |
| − | ** 2- | + | ** δ(L-2-aminoadipyl)-L-cysteinyl-D-valine |
| + | ** N-[L-5-amino-5-carboxypentanoyl]-L-cysteinyl-D-valine | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[1.21.3.1-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | |||
== External links == | == External links == | ||
| − | |||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91820470 91820470] |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58572 58572] |
| − | * | + | * LIGAND-CPD: |
| − | {{#set: smiles=C(O)C(O)C(O) | + | ** [http://www.genome.jp/dbget-bin/www_bget?C05556 C05556] |
| − | {{#set: inchi key=InChIKey= | + | {{#set: smiles=CC(C)C(NC(=O)C(NC(=O)CCCC([N+])C(=O)[O-])CS)C(=O)[O-]}} |
| − | {{#set: common name= | + | {{#set: inchi key=InChIKey=BYEIJZFKOAXBBV-QXEWZRGKSA-M}} |
| − | {{#set: molecular weight= | + | {{#set: common name=N-[(5S)-5-amino-5-carboxypentanoyl]-L-cysteinyl-D-valine}} |
| − | {{#set: common name= | + | {{#set: molecular weight=362.42 }} |
| − | {{#set: | + | {{#set: common name=ACV|L-δ-(α-aminoadipoyl)-L-cysteinyl-D-valine|δ(L-2-aminoadipyl)-L-cysteinyl-D-valine|N-[L-5-amino-5-carboxypentanoyl]-L-cysteinyl-D-valine}} |
| + | {{#set: consumed by=1.21.3.1-RXN}} | ||
Revision as of 13:58, 21 March 2018
Contents
Metabolite N-5S-5-AMINO-5-CARBOXYPENTANOYL-L-CY
- smiles:
- CC(C)C(NC(=O)C(NC(=O)CCCC([N+])C(=O)[O-])CS)C(=O)[O-]
- inchi key:
- InChIKey=BYEIJZFKOAXBBV-QXEWZRGKSA-M
- common name:
- N-[(5S)-5-amino-5-carboxypentanoyl]-L-cysteinyl-D-valine
- molecular weight:
- 362.42
- Synonym(s):
- ACV
- L-δ-(α-aminoadipoyl)-L-cysteinyl-D-valine
- δ(L-2-aminoadipyl)-L-cysteinyl-D-valine
- N-[L-5-amino-5-carboxypentanoyl]-L-cysteinyl-D-valine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)C(NC(=O)C(NC(=O)CCCC([N+])C(=O)[O-])CS)C(=O)[O-" cannot be used as a page name in this wiki.
"N-[(5S)-5-amino-5-carboxypentanoyl]-L-cysteinyl-D-valine" cannot be used as a page name in this wiki.
"N-[L-5-amino-5-carboxypentanoyl]-L-cysteinyl-D-valine" cannot be used as a page name in this wiki.
