Difference between revisions of "TRNA-adenine-37"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Decanoyl-ACPs Decanoyl-ACPs] == * common name: ** a decanoyl-[acp] * Synonym(s): == Reaction(s...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13793 CPD-13793] == * smiles: ** CCC(C(C)C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(=O)CCC(C)1[CH...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Decanoyl-ACPs Decanoyl-ACPs] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13793 CPD-13793] ==
 +
* smiles:
 +
** CCC(C(C)C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(=O)CCC(C)1[CH]2CCC(C)34))))
 +
* inchi key:
 +
** InChIKey=KYOFIJXMVNQYFC-XJZKHKOHSA-N
 
* common name:
 
* common name:
** a decanoyl-[acp]
+
** 3-oxo-24-ethyl-cholest-5-ene
 +
* molecular weight:
 +
** 412.698   
 
* Synonym(s):
 
* Synonym(s):
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-9652]]
 
* [[RXN-9531]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-9660]]
+
* [[RXN-12789]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
{{#set: common name=a decanoyl-[acp]}}
+
* PUBCHEM:
{{#set: consumed by=RXN-9652|RXN-9531}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=9801811 9801811]
{{#set: produced by=RXN-9660}}
+
{{#set: smiles=CCC(C(C)C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(=O)CCC(C)1[CH]2CCC(C)34))))}}
 +
{{#set: inchi key=InChIKey=KYOFIJXMVNQYFC-XJZKHKOHSA-N}}
 +
{{#set: common name=3-oxo-24-ethyl-cholest-5-ene}}
 +
{{#set: molecular weight=412.698    }}
 +
{{#set: produced by=RXN-12789}}

Revision as of 13:58, 21 March 2018

Metabolite CPD-13793

  • smiles:
    • CCC(C(C)C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(=O)CCC(C)1[CH]2CCC(C)34))))
  • inchi key:
    • InChIKey=KYOFIJXMVNQYFC-XJZKHKOHSA-N
  • common name:
    • 3-oxo-24-ethyl-cholest-5-ene
  • molecular weight:
    • 412.698
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CCC(C(C)C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(=O)CCC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.