Difference between revisions of "AICAR"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Thiocarboxylated-MPT-synthases Thiocarboxylated-MPT-synthases] == * common name: ** a thiocarbo...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2461 CPD0-2461] == * smiles: ** C2(=NC1(=C(NC(N=C(N)1)=O)N2)) * inchi key: ** InChIKey=DRA...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2461 CPD0-2461] == |
+ | * smiles: | ||
+ | ** C2(=NC1(=C(NC(N=C(N)1)=O)N2)) | ||
+ | * inchi key: | ||
+ | ** InChIKey=DRAVOWXCEBXPTN-UHFFFAOYSA-N | ||
* common name: | * common name: | ||
− | ** | + | ** isoguanine |
+ | * molecular weight: | ||
+ | ** 151.127 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** 2-oxoadenine | ||
+ | ** 2-hydroxyadenine | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[RXN-15139]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | {{#set: common name= | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=76900 76900] |
− | {{#set: produced by=RXN- | + | * CHEMSPIDER: |
+ | ** [http://www.chemspider.com/Chemical-Structure.69351.html 69351] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62462 62462] | ||
+ | * HMDB : HMDB00403 | ||
+ | {{#set: smiles=C2(=NC1(=C(NC(N=C(N)1)=O)N2))}} | ||
+ | {{#set: inchi key=InChIKey=DRAVOWXCEBXPTN-UHFFFAOYSA-N}} | ||
+ | {{#set: common name=isoguanine}} | ||
+ | {{#set: molecular weight=151.127 }} | ||
+ | {{#set: common name=2-oxoadenine|2-hydroxyadenine}} | ||
+ | {{#set: produced by=RXN-15139}} |
Revision as of 14:59, 21 March 2018
Contents
Metabolite CPD0-2461
- smiles:
- C2(=NC1(=C(NC(N=C(N)1)=O)N2))
- inchi key:
- InChIKey=DRAVOWXCEBXPTN-UHFFFAOYSA-N
- common name:
- isoguanine
- molecular weight:
- 151.127
- Synonym(s):
- 2-oxoadenine
- 2-hydroxyadenine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links