Difference between revisions of "Detyrosinated-alpha--tubulins"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6746 CPD-6746] == * smiles: ** C1(O)(C(O)C(O)C(OP([O-])([O-])=O)C(O)C(O)1) * inchi key: **...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Thiocarboxylated-MPT-synthases Thiocarboxylated-MPT-synthases] == * common name: ** a thiocarbo...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Thiocarboxylated-MPT-synthases Thiocarboxylated-MPT-synthases] == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** a thiocarboxylated small subunit of molybdopterin synthase |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[RXN-8342]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN-12473]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | + | {{#set: common name=a thiocarboxylated small subunit of molybdopterin synthase}} | |
− | + | {{#set: consumed by=RXN-8342}} | |
− | + | {{#set: produced by=RXN-12473}} | |
− | + | ||
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | + | ||
− | {{#set: | + |
Revision as of 13:59, 21 March 2018
Contents
Metabolite Thiocarboxylated-MPT-synthases
- common name:
- a thiocarboxylated small subunit of molybdopterin synthase
- Synonym(s):