Difference between revisions of "Detyrosinated-alpha--tubulins"

Revision as of 13:59, 21 March 2018

@@ Line 1: / Line 1: @@
 [[Category:Metabolite]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6746 CPD-6746] ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Thiocarboxylated-MPT-synthases Thiocarboxylated-MPT-synthases] ==
-* smiles:
-** C1(O)(C(O)C(O)C(OP([O-])([O-])=O)C(O)C(O)1)
-* inchi key:
-** InChIKey=INAPMGSXUVUWAF-QWBQGLJISA-L
 * common name:
-** 1D-myo-inositol 2-monophosphate
+** a thiocarboxylated small subunit of molybdopterin synthase
-* molecular weight:
-** 258.121
 * Synonym(s):
-** D-myo-inositol 2-monophosphate
-** Ins(2)P1
-** Ins(2)P
-** Ins2P
 == Reaction(s) known to consume the compound ==
-* [[RXN-7253]]
+* [[RXN-8342]]
 == Reaction(s) known to produce the compound ==
+* [[RXN-12473]]
 == Reaction(s) of unknown directionality ==
 == External links  ==
-* CHEBI:
+{{#set: common name=a thiocarboxylated small subunit of molybdopterin synthase}}
-** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62383 62383]
+{{#set: consumed by=RXN-8342}}
-{{#set: smiles=C1(O)(C(O)C(O)C(OP([O-])([O-])=O)C(O)C(O)1)}}
+{{#set: produced by=RXN-12473}}
-{{#set: inchi key=InChIKey=INAPMGSXUVUWAF-QWBQGLJISA-L}}
-{{#set: common name=1D-myo-inositol 2-monophosphate}}
-{{#set: molecular weight=258.121    }}
-{{#set: common name=D-myo-inositol 2-monophosphate|Ins(2)P1|Ins(2)P|Ins2P}}
-{{#set: consumed by=RXN-7253}}