Difference between revisions of "Apo-FeS-cluster-proteins"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=O-PHOSPHO-L-HOMOSERINE O-PHOSPHO-L-HOMOSERINE] == * smiles: ** C(COP([O-])(=O)[O-])C([N+])C([O-...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PROT-CYS PROT-CYS] == * common name: ** a [protein]-L-cysteine * Synonym(s): ** peptide cystein...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=O-PHOSPHO-L-HOMOSERINE O-PHOSPHO-L-HOMOSERINE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PROT-CYS PROT-CYS] ==
* smiles:
+
** C(COP([O-])(=O)[O-])C([N+])C([O-])=O
+
* inchi key:
+
** InChIKey=FXDNYOANAXWZHG-VKHMYHEASA-L
+
 
* common name:
 
* common name:
** O-phospho-L-homoserine
+
** a [protein]-L-cysteine
* molecular weight:
+
** 197.084   
+
 
* Synonym(s):
 
* Synonym(s):
** o-phosphohomoserine
+
** peptide cysteine
 +
** peptidyl cysteine
 +
** [enzyme]-cysteine
 +
** protein-cysteine
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[CYSPH-RXN]]
 
* [[THRESYN-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[HOMOSERKIN-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 +
* [[2.5.1.58-RXN]]
 +
* [[RXN-3701]]
 +
* [[1.11.1.15-RXN]]
 
== External links  ==
 
== External links  ==
* BIGG : 36811
+
{{#set: common name=a [protein]-L-cysteine}}
* PUBCHEM:
+
{{#set: common name=peptide cysteine|peptidyl cysteine|[enzyme]-cysteine|protein-cysteine}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46878406 46878406]
+
{{#set: reversible reaction associated=2.5.1.58-RXN|RXN-3701|1.11.1.15-RXN}}
* HMDB : HMDB03484
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C01102 C01102]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57590 57590]
+
* METABOLIGHTS : MTBLC57590
+
{{#set: smiles=C(COP([O-])(=O)[O-])C([N+])C([O-])=O}}
+
{{#set: inchi key=InChIKey=FXDNYOANAXWZHG-VKHMYHEASA-L}}
+
{{#set: common name=O-phospho-L-homoserine}}
+
{{#set: molecular weight=197.084    }}
+
{{#set: common name=o-phosphohomoserine}}
+
{{#set: consumed by=CYSPH-RXN|THRESYN-RXN}}
+
{{#set: produced by=HOMOSERKIN-RXN}}
+

Revision as of 14:59, 21 March 2018

Metabolite PROT-CYS

  • common name:
    • a [protein]-L-cysteine
  • Synonym(s):
    • peptide cysteine
    • peptidyl cysteine
    • [enzyme]-cysteine
    • protein-cysteine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"a [protein]-L-cysteine" cannot be used as a page name in this wiki.
"enzyme]-cysteine" cannot be used as a page name in this wiki.