Difference between revisions of "CPD0-1108"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13295 RXN-13295] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1108 CPD0-1108] == * smiles: ** C(C1(C(O)C(O)C(O)O1))O * inchi key: ** InChIKey=HMFHBZSHGG...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13295 RXN-13295] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1108 CPD0-1108] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C(C1(C(O)C(O)C(O)O1))O
−
* ec number:
+
* inchi key:
−
** [http://enzyme.expasy.org/EC/2.3.1.199 EC-2.3.1.199]
+
** InChIKey=HMFHBZSHGGEWLO-TXICZTDVSA-N
 +
* common name:
 +
** β-D-ribofuranose
 +
* molecular weight:
 +
** 150.131   
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[PROTON]][c] '''+''' 1 [[CPD-9965]][c] '''+''' 1 [[MALONYL-COA]][c] '''=>''' 1 [[CPD-10283]][c] '''+''' 1 [[CO-A]][c] '''+''' 1 [[CARBON-DIOXIDE]][c]
+
== Reaction(s) of unknown directionality ==
−
* With common name(s):
+
* [[RXN-14904]]
−
** 1 H+[c] '''+''' 1 icosanoyl-CoA[c] '''+''' 1 malonyl-CoA[c] '''=>''' 1 3-oxo-behenoyl-CoA[c] '''+''' 1 coenzyme A[c] '''+''' 1 CO2[c]
+
* [[RXN0-5305]]
−
 
+
−
== Genes associated with this reaction  ==
+
−
== Pathways  ==
+
−
* [[PWY-7036]], very long chain fatty acid biosynthesis II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7036 PWY-7036]
+
−
** '''4''' reactions found over '''16''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[gap-filling]]:
+
−
** [[meneco]]:
+
−
*** [[added for gapfilling]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* LIGAND-CPD:
−
{{#set: ec number=EC-2.3.1.199}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C16639 C16639]
−
{{#set: in pathway=PWY-7036}}
+
* CHEMSPIDER:
−
{{#set: reconstruction category=gap-filling}}
+
** [http://www.chemspider.com/Chemical-Structure.394477.html 394477]
−
{{#set: reconstruction tool=meneco}}
+
* CHEBI:
−
{{#set: reconstruction source=added for gapfilling}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=47002 47002]
 +
* PUBCHEM:
 +
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=447347 447347]
 +
{{#set: smiles=C(C1(C(O)C(O)C(O)O1))O}}
 +
{{#set: inchi key=InChIKey=HMFHBZSHGGEWLO-TXICZTDVSA-N}}
 +
{{#set: common name=β-D-ribofuranose}}
 +
{{#set: molecular weight=150.131    }}
 +
{{#set: reversible reaction associated=RXN-14904|RXN0-5305}}

Latest revision as of 18:59, 21 March 2018

Metabolite CPD0-1108

  • smiles:
    • C(C1(C(O)C(O)C(O)O1))O
  • inchi key:
    • InChIKey=HMFHBZSHGGEWLO-TXICZTDVSA-N
  • common name:
    • β-D-ribofuranose
  • molecular weight:
    • 150.131
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links



Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=CPD0-1108&oldid=23635"