Difference between revisions of "RXN-13519"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FARNESYL-PP FARNESYL-PP] == * smiles: ** CC(=CCCC(=CCCC(=CCOP(OP([O-])(=O)[O-])(=O)[O-])C)C)C *...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13519 RXN-13519] == * direction: ** LEFT-TO-RIGHT * common name: ** vectoral H+ export * Synony...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13519 RXN-13519] == |
| − | * | + | * direction: |
| − | ** | + | ** LEFT-TO-RIGHT |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** vectoral H+ export |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | == Reaction | + | == Reaction Formula == |
| − | * | + | * With identifiers: |
| − | * [[ | + | ** 4 [[PROTON]][c] '''=>''' 4 [[PROTON]][e] |
| − | + | * With common name(s): | |
| − | + | ** 4 H+[c] '''=>''' 4 H+[e] | |
| − | + | ||
| − | + | == Genes associated with this reaction == | |
| − | * [[ | + | == Pathways == |
| − | == | + | == Reconstruction information == |
| − | * [[ | + | * Category: [[annotation]] |
| − | * [[ | + | ** Source: [[annotation-esiliculosus_genome]] |
| + | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
| − | + | {{#set: direction=LEFT-TO-RIGHT}} | |
| − | + | {{#set: common name=vectoral H+ export}} | |
| − | + | {{#set: in pathway=}} | |
| − | + | {{#set: reconstruction category=annotation}} | |
| − | + | {{#set: reconstruction source=annotation-esiliculosus_genome}} | |
| − | + | {{#set: reconstruction tool=pathwaytools}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | + | ||
Latest revision as of 18:59, 21 March 2018
Contents
Reaction RXN-13519
- direction:
- LEFT-TO-RIGHT
- common name:
- vectoral H+ export
- Synonym(s):
Reaction Formula
Genes associated with this reaction
Pathways
Reconstruction information
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome
