Difference between revisions of "Ec-01 008360"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1107 CPD0-1107] == * smiles: ** CC1(OC(C(C(C1O)O)O)O) * inchi key: ** InChIKey=SHZGCJCMOBC...")
 
(Created page with "Category:Gene == Gene Ec-01_008360 == * left end position: ** 7130127 * transcription direction: ** NEGATIVE * right end position: ** 7132974 * centisome position: ** 69.0...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1107 CPD0-1107] ==
+
== Gene Ec-01_008360 ==
−
* smiles:
+
* left end position:
−
** CC1(OC(C(C(C1O)O)O)O)
+
** 7130127
−
* inchi key:
+
* transcription direction:
−
** InChIKey=SHZGCJCMOBCMKK-KGJVWPDLSA-N
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** β-L-fucopyranose
+
** 7132974
−
* molecular weight:
+
* centisome position:
−
** 164.158    
+
** 69.09819    
 
* Synonym(s):
 
* Synonym(s):
−
** β-L-fucose
+
** Esi_0002_0022
 +
** Esi0002_0022
 +
** MRK?
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[PROTEIN-KINASE-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** Source: [[annotation-esiliculosus_genome]]
−
* [[RXN0-5298]]
+
*** Assignment: go-term
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* DRUGBANK : DB03283
+
{{#set: left end position=7130127}}
−
* PUBCHEM:
+
{{#set: transcription direction=NEGATIVE}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=444863 444863]
+
{{#set: right end position=7132974}}
−
* HMDB : HMDB59625
+
{{#set: centisome position=69.09819   }}
−
* LIGAND-CPD:
+
{{#set: common name=Esi_0002_0022|Esi0002_0022|MRK?}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C01019 C01019]
+
{{#set: reaction associated=PROTEIN-KINASE-RXN}}
−
* CHEMSPIDER:
+
−
** [http://www.chemspider.com/Chemical-Structure.392667.html 392667]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=42589 42589]
+
−
{{#set: smiles=CC1(OC(C(C(C1O)O)O)O)}}
+
−
{{#set: inchi key=InChIKey=SHZGCJCMOBCMKK-KGJVWPDLSA-N}}
+
−
{{#set: common name=β-L-fucopyranose}}
+
−
{{#set: molecular weight=164.158   }}
+
−
{{#set: common name=β-L-fucose}}
+
−
{{#set: consumed or produced by=RXN0-5298}}
+

Latest revision as of 19:59, 21 March 2018

Gene Ec-01_008360

  • left end position:
    • 7130127
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 7132974
  • centisome position:
    • 69.09819
  • Synonym(s):
    • Esi_0002_0022
    • Esi0002_0022
    • MRK?

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-01_008360&oldid=23660"