Difference between revisions of "CPD-16819"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16317 RXN-16317] == * direction: ** REVERSIBLE * common name: ** Mitogen-activated protein kina...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16819 CPD-16819] == * smiles: ** CC1(C=CC(=CC=1)OS(=O)(=O)[O-]) * inchi key: ** InChIKey=WG...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16317 RXN-16317] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16819 CPD-16819] ==
−
* direction:
+
* smiles:
−
** REVERSIBLE
+
** CC1(C=CC(=CC=1)OS(=O)(=O)[O-])
 +
* inchi key:
 +
** InChIKey=WGNAKZGUSRVWRH-UHFFFAOYSA-M
 
* common name:
 
* common name:
−
** Mitogen-activated protein kinase kinase (MAP2K)
+
** 4-methylphenyl sulfate
−
* ec number:
+
* molecular weight:
−
** [http://enzyme.expasy.org/EC/2.7.12.2 EC-2.7.12.2]
+
** 187.19   
 
* Synonym(s):
 
* Synonym(s):
 +
** p-cresol sulfate
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[ATP]][c] '''+''' 1 [[MAP-Kinase-L-Tyr]][c] '''<=>''' 1 [[PROTON]][c] '''+''' 1 [[MAP-Kinase-L-Phosphotyrosine]][c] '''+''' 1 [[ADP]][c]
+
== Reaction(s) of unknown directionality ==
−
* With common name(s):
+
* [[RXN-15588]]
−
** 1 ATP[c] '''+''' 1 a [mitogen-activated protein kinase]-L-tyrosine[c] '''<=>''' 1 H+[c] '''+''' 1 a [mitogen-activated protein kinase] L-tyrosine phosphate[c] '''+''' 1 ADP[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Ec-08_005740]]
+
−
** ESILICULOSUS_GENOME
+
−
***AUTOMATED-NAME-MATCH
+
−
== Pathways  ==
+
−
== Reconstruction information  ==
+
−
* Category: [[annotation]]
+
−
** Source: [[annotation-esiliculosus_genome]]
+
−
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=REVERSIBLE}}
+
* PUBCHEM:
−
{{#set: common name=Mitogen-activated protein kinase kinase (MAP2K)}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=4615422 4615422]
−
{{#set: ec number=EC-2.7.12.2}}
+
* CHEMSPIDER:
−
{{#set: gene associated=Ec-08_005740}}
+
** [http://www.chemspider.com/Chemical-Structure.3806481.html 3806481]
−
{{#set: in pathway=}}
+
* HMDB : HMDB11635
−
{{#set: reconstruction category=annotation}}
+
{{#set: smiles=CC1(C=CC(=CC=1)OS(=O)(=O)[O-])}}
−
{{#set: reconstruction source=annotation-esiliculosus_genome}}
+
{{#set: inchi key=InChIKey=WGNAKZGUSRVWRH-UHFFFAOYSA-M}}
−
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: common name=4-methylphenyl sulfate}}
 +
{{#set: molecular weight=187.19    }}
 +
{{#set: common name=p-cresol sulfate}}
 +
{{#set: reversible reaction associated=RXN-15588}}

Latest revision as of 18:59, 21 March 2018

Metabolite CPD-16819

  • smiles:
    • CC1(C=CC(=CC=1)OS(=O)(=O)[O-])
  • inchi key:
    • InChIKey=WGNAKZGUSRVWRH-UHFFFAOYSA-M
  • common name:
    • 4-methylphenyl sulfate
  • molecular weight:
    • 187.19
  • Synonym(s):
    • p-cresol sulfate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC1(C=CC(=CC=1)OS(=O)(=O)[O-])" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=CPD-16819&oldid=23665"