Difference between revisions of "PWY-7646"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16819 CPD-16819] == * smiles: ** CC1(C=CC(=CC=1)OS(=O)(=O)[O-]) * inchi key: ** InChIKey=WG...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7646 PWY-7646] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] *...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7646 PWY-7646] == |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** dermatan sulfate degradation I (bacterial) |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | + | '''1''' reactions found over '''4''' reactions in the full pathway | |
| − | == Reaction(s) | + | * [[RXN-12178]] |
| − | * [[RXN- | + | ** 2 associated gene(s): |
| + | *** [[Ec-02_002970]] | ||
| + | *** [[Ec-02_002980]] | ||
| + | ** 1 reconstruction source(s) associated: | ||
| + | *** [[annotation-esiliculosus_genome]] | ||
| + | == Reaction(s) not found == | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=4.2.2.19-RXN 4.2.2.19-RXN] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=CHONDRO-4-SULFATASE-RXN CHONDRO-4-SULFATASE-RXN] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-11577 RXN-11577] | ||
== External links == | == External links == | ||
| − | + | {{#set: taxonomic range=TAX-2}} | |
| − | + | {{#set: common name=dermatan sulfate degradation I (bacterial)}} | |
| − | + | {{#set: reaction found=1}} | |
| − | + | {{#set: total reaction=4}} | |
| − | + | {{#set: completion rate=25.0}} | |
| − | {{#set: | + | |
| − | + | ||
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 18:59, 21 March 2018
Pathway PWY-7646
- taxonomic range:
- common name:
- dermatan sulfate degradation I (bacterial)
- Synonym(s):
Reaction(s) found
1 reactions found over 4 reactions in the full pathway
- RXN-12178
- 2 associated gene(s):
- 1 reconstruction source(s) associated:
