Difference between revisions of "PROTOPORPHYRIN IX"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14642 RXN-14642] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PROTOPORPHYRIN_IX PROTOPORPHYRIN_IX] == * smiles: ** C=CC1(C(C)=C2(C=C5(C(C)=C(CCC([O-])=O)C(C=...")
 
Line 1: Line 1:
[[Category:Reaction]]
+
[[Category:Metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14642 RXN-14642] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PROTOPORPHYRIN_IX PROTOPORPHYRIN_IX] ==
* direction:
+
* smiles:
** LEFT-TO-RIGHT
+
** C=CC1(C(C)=C2(C=C5(C(C)=C(CCC([O-])=O)C(C=C4(C(CCC([O-])=O)=C(C)C(=CC3(C(C=C)=C(C)C(=CC=1N2)N=3))N4))=N5)))
* ec number:
+
* inchi key:
** [http://enzyme.expasy.org/EC/1.2.1 EC-1.2.1]
+
** InChIKey=KSFOVUSSGSKXFI-UJJXFSCMSA-L
 +
* common name:
 +
** protoporphyrin IX
 +
* molecular weight:
 +
** 560.651   
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
* With identifiers:
+
* [[RXN1F-20]]
** 1 [[Acceptor]][c] '''+''' 1 [[GLYCOLALDEHYDE]][c] '''=>''' 1 [[PROTON]][c] '''+''' 1 [[GLYCOLLATE]][c] '''+''' 1 [[Donor-H2]][c]
+
== Reaction(s) known to produce the compound ==
* With common name(s):
+
* [[PROTOPORGENOXI-RXN]]
** 1 an oxidized unknown electron acceptor[c] '''+''' 1 glycolaldehyde[c] '''=>''' 1 H+[c] '''+''' 1 glycolate[c] '''+''' 1 an reduced unknown electron acceptor[c]
+
== Reaction(s) of unknown directionality ==
 
+
* [[PROTOHEMEFERROCHELAT-RXN]]
== Genes associated with this reaction  ==
+
== Pathways  ==
+
* [[PWY-7295]], L-arabinose degradation IV: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7295 PWY-7295]
+
** '''3''' reactions found over '''8''' reactions in the full pathway
+
* [[PWY-7294]], xylose degradation IV: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7294 PWY-7294]
+
** '''3''' reactions found over '''7''' reactions in the full pathway
+
== Reconstruction information  ==
+
* Category: [[gap-filling]]
+
** Source: [[gap-filling-gapfilling_solution_with_meneco_draft_medium]]
+
*** Tool: [[meneco]]
+
**** Comment: [[added for gapfilling]]
+
 
== External links  ==
 
== External links  ==
{{#set: direction=LEFT-TO-RIGHT}}
+
* CAS : 553-12-8
{{#set: ec number=EC-1.2.1}}
+
* PUBCHEM:
{{#set: in pathway=PWY-7295|PWY-7294}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=3794562 3794562]
{{#set: reconstruction category=gap-filling}}
+
* HMDB : HMDB00241
{{#set: reconstruction source=gap-filling-gapfilling_solution_with_meneco_draft_medium}}
+
* LIGAND-CPD:
{{#set: reconstruction tool=meneco}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C02191 C02191]
{{#set: reconstruction comment=added for gapfilling}}
+
* CHEMSPIDER:
 +
** [http://www.chemspider.com/Chemical-Structure.20171337.html 20171337]
 +
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57306 57306]
 +
* BIGG : 39293
 +
{{#set: smiles=C=CC1(C(C)=C2(C=C5(C(C)=C(CCC([O-])=O)C(C=C4(C(CCC([O-])=O)=C(C)C(=CC3(C(C=C)=C(C)C(=CC=1N2)N=3))N4))=N5)))}}
 +
{{#set: inchi key=InChIKey=KSFOVUSSGSKXFI-UJJXFSCMSA-L}}
 +
{{#set: common name=protoporphyrin IX}}
 +
{{#set: molecular weight=560.651    }}
 +
{{#set: consumed by=RXN1F-20}}
 +
{{#set: produced by=PROTOPORGENOXI-RXN}}
 +
{{#set: reversible reaction associated=PROTOHEMEFERROCHELAT-RXN}}

Latest revision as of 18:59, 21 March 2018

Metabolite PROTOPORPHYRIN_IX

  • smiles:
    • C=CC1(C(C)=C2(C=C5(C(C)=C(CCC([O-])=O)C(C=C4(C(CCC([O-])=O)=C(C)C(=CC3(C(C=C)=C(C)C(=CC=1N2)N=3))N4))=N5)))
  • inchi key:
    • InChIKey=KSFOVUSSGSKXFI-UJJXFSCMSA-L
  • common name:
    • protoporphyrin IX
  • molecular weight:
    • 560.651
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C=CC1(C(C)=C2(C=C5(C(C)=C(CCC([O-])=O)C(C=C4(C(CCC([O-])=O)=C(C)C(=CC3(C(C=C)=C(C)C(=CC=1N2)N=3))N4))=N5)))" cannot be used as a page name in this wiki.