Difference between revisions of "CPD-19157"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY490-3 PWY490-3] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1117 TAX-11...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19157 CPD-19157] == * smiles: ** CCCCCCC=CCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Pathway]]
+
[[Category:Metabolite]]
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY490-3 PWY490-3] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19157 CPD-19157] ==
* taxonomic range:
+
* smiles:
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1117 TAX-1117]
+
** CCCCCCC=CCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
 +
* inchi key:
 +
** InChIKey=BEPLLRGJVXAEJI-TWAFKMGKSA-J
 
* common name:
 
* common name:
** nitrate reduction VI (assimilatory)
+
** 3-oxo-(7Z)-tetradecenoyl-CoA
 +
* molecular weight:
 +
** 985.829   
 
* Synonym(s):
 
* Synonym(s):
** nitrate assimilation
+
** 3-oxo-14:1-Δ7-CoA
 +
** 3-oxo-7-cis-tetradecenoyl-CoA
  
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
* '''3''' reaction(s) found
+
== Reaction(s) known to produce the compound ==
** [[FERREDOXIN--NITRITE-REDUCTASE-RXN]]
+
* [[RXN-17794]]
** [[GLUTAMINESYN-RXN]]
+
== Reaction(s) of unknown directionality ==
** [[GLUTDEHYD-RXN]]
+
== Reaction(s) not found ==
+
* '''1''' reaction(s) not found
+
** [http://metacyc.org/META/NEW-IMAGE?object=1.7.7.2-RXN 1.7.7.2-RXN]
+
 
== External links  ==
 
== External links  ==
{{#set: taxonomic range=TAX-1117}}
+
{{#set: smiles=CCCCCCC=CCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
{{#set: common name=nitrate reduction VI (assimilatory)}}
+
{{#set: inchi key=InChIKey=BEPLLRGJVXAEJI-TWAFKMGKSA-J}}
{{#set: common name=nitrate assimilation}}
+
{{#set: common name=3-oxo-(7Z)-tetradecenoyl-CoA}}
{{#set: reaction found=3}}
+
{{#set: molecular weight=985.829    }}
{{#set: reaction not found=1}}
+
{{#set: common name=3-oxo-14:1-Δ7-CoA|3-oxo-7-cis-tetradecenoyl-CoA}}
 +
{{#set: produced by=RXN-17794}}

Latest revision as of 19:00, 21 March 2018

Metabolite CPD-19157

  • smiles:
    • CCCCCCC=CCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
  • inchi key:
    • InChIKey=BEPLLRGJVXAEJI-TWAFKMGKSA-J
  • common name:
    • 3-oxo-(7Z)-tetradecenoyl-CoA
  • molecular weight:
    • 985.829
  • Synonym(s):
    • 3-oxo-14:1-Δ7-CoA
    • 3-oxo-7-cis-tetradecenoyl-CoA

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CCCCCCC=CCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.