Difference between revisions of "CPD-8268"
From metabolic_network
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-31 PWY-31] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3803 TAX-3803]...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8268 CPD-8268] == * smiles: ** CCCCCCCCC=CCCCCCCCC(OCC(OC(=O)CCCCCCCC=CCCCCCCCC)COP([O-])(=...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8268 CPD-8268] == |
− | * | + | * smiles: |
− | ** [ | + | ** CCCCCCCCC=CCCCCCCCC(OCC(OC(=O)CCCCCCCC=CCCCCCCCC)COP([O-])(=O)[O-])=O |
+ | * inchi key: | ||
+ | ** InChIKey=MHUWZNTUIIFHAS-DSSVUWSHSA-L | ||
* common name: | * common name: | ||
− | ** | + | ** dioleoyl phosphatidate |
+ | * molecular weight: | ||
+ | ** 698.959 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** 18:1-18:1-PA | ||
+ | ** 1-18:1-2-18:1-phosphatidic acid | ||
+ | ** 1,2-(9Z-octadecenoyl)-sn-glycero-3-phosphate | ||
+ | ** 1-18:1-2-18:1-phosphatidate | ||
− | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
− | + | * [[RXN-15068]] | |
− | * [[RXN- | + | == Reaction(s) known to produce the compound == |
− | + | * [[RXN-15043]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | == Reaction(s) | + | |
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: common name= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245731 25245731] |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=83308 83308] |
− | {{#set: | + | * HMDB : HMDB07865 |
+ | {{#set: smiles=CCCCCCCCC=CCCCCCCCC(OCC(OC(=O)CCCCCCCC=CCCCCCCCC)COP([O-])(=O)[O-])=O}} | ||
+ | {{#set: inchi key=InChIKey=MHUWZNTUIIFHAS-DSSVUWSHSA-L}} | ||
+ | {{#set: common name=dioleoyl phosphatidate}} | ||
+ | {{#set: molecular weight=698.959 }} | ||
+ | {{#set: common name=18:1-18:1-PA|1-18:1-2-18:1-phosphatidic acid|1,2-(9Z-octadecenoyl)-sn-glycero-3-phosphate|1-18:1-2-18:1-phosphatidate}} | ||
+ | {{#set: consumed by=RXN-15068}} | ||
+ | {{#set: produced by=RXN-15043}} |
Latest revision as of 19:00, 21 March 2018
Contents
Metabolite CPD-8268
- smiles:
- CCCCCCCCC=CCCCCCCCC(OCC(OC(=O)CCCCCCCC=CCCCCCCCC)COP([O-])(=O)[O-])=O
- inchi key:
- InChIKey=MHUWZNTUIIFHAS-DSSVUWSHSA-L
- common name:
- dioleoyl phosphatidate
- molecular weight:
- 698.959
- Synonym(s):
- 18:1-18:1-PA
- 1-18:1-2-18:1-phosphatidic acid
- 1,2-(9Z-octadecenoyl)-sn-glycero-3-phosphate
- 1-18:1-2-18:1-phosphatidate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCCCCCCCC=CCCCCCCCC(OCC(OC(=O)CCCCCCCC=CCCCCCCCC)COP([O-])(=O)[O-])=O" cannot be used as a page name in this wiki.