Difference between revisions of "CPD-8268"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8268 CPD-8268] == * smiles: ** CCCCCCCCC=CCCCCCCCC(OCC(OC(=O)CCCCCCCC=CCCCCCCCC)COP([O-])(=...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Pathway]]
+
[[Category:Metabolite]]
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6959 PWY-6959] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8268 CPD-8268] ==
* taxonomic range:
+
* smiles:
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090]
+
** CCCCCCCCC=CCCCCCCCC(OCC(OC(=O)CCCCCCCC=CCCCCCCCC)COP([O-])(=O)[O-])=O
 +
* inchi key:
 +
** InChIKey=MHUWZNTUIIFHAS-DSSVUWSHSA-L
 
* common name:
 
* common name:
** L-ascorbate degradation V
+
** dioleoyl phosphatidate
 +
* molecular weight:
 +
** 698.959   
 
* Synonym(s):
 
* Synonym(s):
 +
** 18:1-18:1-PA
 +
** 1-18:1-2-18:1-phosphatidic acid
 +
** 1,2-(9Z-octadecenoyl)-sn-glycero-3-phosphate
 +
** 1-18:1-2-18:1-phosphatidate
  
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
'''5''' reactions found over '''5''' reactions in the full pathway
+
* [[RXN-15068]]
* [[RXN-12440]]
+
== Reaction(s) known to produce the compound ==
* [[RXN-12861]]
+
* [[RXN-15043]]
* [[RXN-12862]]
+
== Reaction(s) of unknown directionality ==
* [[RXN-12870]]
+
* [[RXN-12871]]
+
== Reaction(s) not found ==
+
 
== External links  ==
 
== External links  ==
{{#set: taxonomic range=TAX-33090}}
+
* PUBCHEM:
{{#set: common name=L-ascorbate degradation V}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245731 25245731]
{{#set: reaction found=5}}
+
* CHEBI:
{{#set: reaction not found=5}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=83308 83308]
{{#set: completion rate=100.0}}
+
* HMDB : HMDB07865
 +
{{#set: smiles=CCCCCCCCC=CCCCCCCCC(OCC(OC(=O)CCCCCCCC=CCCCCCCCC)COP([O-])(=O)[O-])=O}}
 +
{{#set: inchi key=InChIKey=MHUWZNTUIIFHAS-DSSVUWSHSA-L}}
 +
{{#set: common name=dioleoyl phosphatidate}}
 +
{{#set: molecular weight=698.959    }}
 +
{{#set: common name=18:1-18:1-PA|1-18:1-2-18:1-phosphatidic acid|1,2-(9Z-octadecenoyl)-sn-glycero-3-phosphate|1-18:1-2-18:1-phosphatidate}}
 +
{{#set: consumed by=RXN-15068}}
 +
{{#set: produced by=RXN-15043}}

Latest revision as of 19:00, 21 March 2018

Metabolite CPD-8268

  • smiles:
    • CCCCCCCCC=CCCCCCCCC(OCC(OC(=O)CCCCCCCC=CCCCCCCCC)COP([O-])(=O)[O-])=O
  • inchi key:
    • InChIKey=MHUWZNTUIIFHAS-DSSVUWSHSA-L
  • common name:
    • dioleoyl phosphatidate
  • molecular weight:
    • 698.959
  • Synonym(s):
    • 18:1-18:1-PA
    • 1-18:1-2-18:1-phosphatidic acid
    • 1,2-(9Z-octadecenoyl)-sn-glycero-3-phosphate
    • 1-18:1-2-18:1-phosphatidate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CCCCCCCCC=CCCCCCCCC(OCC(OC(=O)CCCCCCCC=CCCCCCCCC)COP([O-])(=O)[O-])=O" cannot be used as a page name in this wiki.