Difference between revisions of "GAMA-TOCOPHEROL"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-06_009160 == * left end position: ** 6784601 * transcription direction: ** NEGATIVE * right end position: ** 6789005 * centisome position: ** 77.4...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GAMA-TOCOPHEROL GAMA-TOCOPHEROL] == * smiles: ** CC(C)CCCC(C)CCCC(C)CCCC1(C)(CCC2(=CC(O)=C(C)C(...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GAMA-TOCOPHEROL GAMA-TOCOPHEROL] == |
− | * | + | * smiles: |
− | ** | + | ** CC(C)CCCC(C)CCCC(C)CCCC1(C)(CCC2(=CC(O)=C(C)C(=C(O1)2)C)) |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=QUEDXNHFTDJVIY-DQCZWYHMSA-N |
− | * | + | * common name: |
− | ** | + | ** γ-tocopherol |
− | * | + | * molecular weight: |
− | ** | + | ** 416.686 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** 7,8-dimethyltocol |
− | + | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[TOCOPHEROL-O-METHYLTRANSFERASE-RXN]] |
− | + | == Reaction(s) known to produce the compound == | |
− | * | + | * [[RXN-2543]] |
− | == | + | == Reaction(s) of unknown directionality == |
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=92729 92729] |
− | {{#set: | + | * CHEMSPIDER: |
− | {{#set: | + | ** [http://www.chemspider.com/Chemical-Structure.83708.html 83708] |
− | {{#set: common name= | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=18185 18185] |
+ | * METABOLIGHTS : MTBLC18185 | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C02483 C02483] | ||
+ | {{#set: smiles=CC(C)CCCC(C)CCCC(C)CCCC1(C)(CCC2(=CC(O)=C(C)C(=C(O1)2)C))}} | ||
+ | {{#set: inchi key=InChIKey=QUEDXNHFTDJVIY-DQCZWYHMSA-N}} | ||
+ | {{#set: common name=γ-tocopherol}} | ||
+ | {{#set: molecular weight=416.686 }} | ||
+ | {{#set: common name=7,8-dimethyltocol}} | ||
+ | {{#set: consumed by=TOCOPHEROL-O-METHYLTRANSFERASE-RXN}} | ||
+ | {{#set: produced by=RXN-2543}} |
Latest revision as of 20:00, 21 March 2018
Contents
Metabolite GAMA-TOCOPHEROL
- smiles:
- CC(C)CCCC(C)CCCC(C)CCCC1(C)(CCC2(=CC(O)=C(C)C(=C(O1)2)C))
- inchi key:
- InChIKey=QUEDXNHFTDJVIY-DQCZWYHMSA-N
- common name:
- γ-tocopherol
- molecular weight:
- 416.686
- Synonym(s):
- 7,8-dimethyltocol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links