Difference between revisions of "PWY-5913"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=INDOLE_ACETALDEHYDE INDOLE_ACETALDEHYDE] == * smiles: ** C(CC1(C2(=C(NC=1)C=CC=C2)))=O * inchi...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5913 PWY-5913] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1118 TAX-11...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=INDOLE_ACETALDEHYDE INDOLE_ACETALDEHYDE] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5913 PWY-5913] ==
−
* smiles:
+
* taxonomic range:
−
** C(CC1(C2(=C(NC=1)C=CC=C2)))=O
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1118 TAX-1118]
−
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1217 TAX-1217]
−
** InChIKey=WHOOUMGHGSPMGR-UHFFFAOYSA-N
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1224 TAX-1224]
 
* common name:
 
* common name:
−
** indole acetaldehyde
+
** partial TCA cycle (obligate autotrophs)
−
* molecular weight:
+
−
** 159.187   
+
 
* Synonym(s):
 
* Synonym(s):
−
** indole-3-acetaldehyde
+
** TCA cycle VI (obligate autotrophs)
−
** 2-(indol-3-yl)acetaldehyde
+
−
** (indol-3-yl)acetaldehyde
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
* [[RXN-5581]]
+
'''10''' reactions found over '''11''' reactions in the full pathway
−
* [[RXN-10715]]
+
* [[ACONITATEDEHYDR-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** 2 associated gene(s):
−
== Reaction(s) of unknown directionality ==
+
*** [[Ec-16_001000]]
 +
*** [[Ec-12_000170]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[ACONITATEHYDR-RXN]]
 +
** 2 associated gene(s):
 +
*** [[Ec-16_001000]]
 +
*** [[Ec-12_000170]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[ASPAMINOTRANS-RXN]]
 +
** 3 associated gene(s):
 +
*** [[Ec-03_003270]]
 +
*** [[Ec-01_007480]]
 +
*** [[Ec-23_003500]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
* [[CITSYN-RXN]]
 +
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[FUMHYDR-RXN]]
 +
** 2 associated gene(s):
 +
*** [[Ec-25_001360]]
 +
*** [[Ec-23_003460]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
* [[GLUTDEHYD-RXN]]
 +
** 2 associated gene(s):
 +
*** [[Ec-06_008240]]
 +
*** [[Ec-12_008040]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[ISOCITDEH-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Ec-11_003080]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[MALATE-DEH-RXN]]
 +
** 2 associated gene(s):
 +
*** [[Ec-10_006200]]
 +
*** [[Ec-02_003100]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
* [[PEPCARBOX-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Ec-28_003470]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[SUCCCOASYN-RXN]]
 +
** 2 associated gene(s):
 +
*** [[Ec-10_000030]]
 +
*** [[Ec-02_001020]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
*** [[orthology-aragem]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-14970 RXN-14970]
 
== External links  ==
 
== External links  ==
−
* CAS : 2591-98-2
+
{{#set: taxonomic range=TAX-1118}}
−
* PUBCHEM:
+
{{#set: taxonomic range=TAX-1217}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=800 800]
+
{{#set: taxonomic range=TAX-1224}}
−
* HMDB : HMDB01190
+
{{#set: common name=partial TCA cycle (obligate autotrophs)}}
−
* LIGAND-CPD:
+
{{#set: common name=TCA cycle VI (obligate autotrophs)}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00637 C00637]
+
{{#set: reaction found=10}}
−
* CHEMSPIDER:
+
{{#set: total reaction=11}}
−
** [http://www.chemspider.com/Chemical-Structure.778.html 778]
+
{{#set: completion rate=91.0}}
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=18086 18086]
+
−
* METABOLIGHTS : MTBLC18086
+
−
{{#set: smiles=C(CC1(C2(=C(NC=1)C=CC=C2)))=O}}
+
−
{{#set: inchi key=InChIKey=WHOOUMGHGSPMGR-UHFFFAOYSA-N}}
+
−
{{#set: common name=indole acetaldehyde}}
+
−
{{#set: molecular weight=159.187    }}
+
−
{{#set: common name=indole-3-acetaldehyde|2-(indol-3-yl)acetaldehyde|(indol-3-yl)acetaldehyde}}
+
−
{{#set: consumed by=RXN-5581|RXN-10715}}
+

Latest revision as of 19:00, 21 March 2018

Pathway PWY-5913

  • taxonomic range:
  • common name:
    • partial TCA cycle (obligate autotrophs)
  • Synonym(s):
    • TCA cycle VI (obligate autotrophs)

Reaction(s) found

10 reactions found over 11 reactions in the full pathway

Reaction(s) not found

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=PWY-5913&oldid=23763"