Difference between revisions of "Ec-08 003110"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=XANTHOSINE XANTHOSINE] == * smiles: ** C(O)C1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC(=O)NC=23))) * inchi...") |
(Created page with "Category:Gene == Gene Ec-08_003110 == * left end position: ** 2936033 * transcription direction: ** NEGATIVE * right end position: ** 2943565 * centisome position: ** 43.8...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-08_003110 == |
− | * | + | * left end position: |
− | ** | + | ** 2936033 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 2943565 |
− | * | + | * centisome position: |
− | ** | + | ** 43.840588 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0126_0001 |
+ | ** Esi0126_0001 | ||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[PHOSCHOL-RXN]] | |
− | * [[ | + | ** Source: [[annotation-esiliculosus_genome]] |
− | == | + | *** Assignment: go-term |
+ | == Pathways associated == | ||
+ | * [[PWY-3561]] | ||
+ | * [[PWY-7039]] | ||
+ | * [[LIPASYN-PWY]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=2936033}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=2943565}} | |
− | + | {{#set: centisome position=43.840588 }} | |
− | + | {{#set: common name=Esi_0126_0001|Esi0126_0001}} | |
− | + | {{#set: reaction associated=PHOSCHOL-RXN}} | |
− | + | {{#set: pathway associated=PWY-3561|PWY-7039|LIPASYN-PWY}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + |
Latest revision as of 19:01, 21 March 2018
Gene Ec-08_003110
- left end position:
- 2936033
- transcription direction:
- NEGATIVE
- right end position:
- 2943565
- centisome position:
- 43.840588
- Synonym(s):
- Esi_0126_0001
- Esi0126_0001
Reactions associated
- Reaction: PHOSCHOL-RXN
- Source: annotation-esiliculosus_genome
- Assignment: go-term
- Source: annotation-esiliculosus_genome