Difference between revisions of "RXN-11245"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LUTEOLIN-7-O-BETA-D-DIGLUCURONIDE LUTEOLIN-7-O-BETA-D-DIGLUCURONIDE] == * smiles: ** C(C5(OC(OC...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11245 RXN-11245] == * direction: ** LEFT-TO-RIGHT * common name: ** 3-hydroxyacyl-CoA dehydroge...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LUTEOLIN-7-O-BETA-D-DIGLUCURONIDE LUTEOLIN-7-O-BETA-D-DIGLUCURONIDE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11245 RXN-11245] ==
−
* smiles:
+
* direction:
−
** C(C5(OC(OC1(C(C(C(C([O-])=O)OC1OC4(C=C3(C(C(C=C(C2(=CC=C(C(=C2)O)O))O3)=O)=C(C=4)O)))O)O))C(C(C5O)O)O))([O-])=O
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=PBBVWJQPAZYQDB-DBFWEQBMSA-L
+
 
* common name:
 
* common name:
−
** luteolin 7-O-β-D-diglucuronide
+
** 3-hydroxyacyl-CoA dehydrogenase
−
* molecular weight:
+
** 6-phosphogluconate dehydrogenase, C-terminal-like
−
** 636.476   
+
* ec number:
 +
** [http://enzyme.expasy.org/EC/1.1.1.35 EC-1.1.1.35]
 
* Synonym(s):
 
* Synonym(s):
−
** luteolin 7-O-[β-D-glucosyluronate-(1->2)-β-D-glucuronide]
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-15288]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[NAD]][c] '''+''' 1 [[CPD-12199]][c] '''=>''' 1 [[NADH]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[CPD-10600]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 NAD+[c] '''+''' 1 3S-(4-hydroxyphenyl)-3-hydroxy-propanoyl-CoA[c] '''=>''' 1 NADH[c] '''+''' 1 H+[c] '''+''' 1 4-hydroxybenzoyl-acetyl-CoA[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-19_005290]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Ec-14_006530]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: GO-TERM
 +
== Pathways  ==
 +
* [[PWY-6435]], 4-hydroxybenzoate biosynthesis V: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6435 PWY-6435]
 +
** '''3''' reactions found over '''5''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46878427 46878427]
+
{{#set: common name=3-hydroxyacyl-CoA dehydrogenase}}
−
* CHEBI:
+
{{#set: common name=6-phosphogluconate dehydrogenase, C-terminal-like}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57815 57815]
+
{{#set: ec number=EC-1.1.1.35}}
−
* LIGAND-CPD:
+
{{#set: gene associated=Ec-19_005290|Ec-14_006530}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C12632 C12632]
+
{{#set: in pathway=PWY-6435}}
−
* HMDB : HMDB60297
+
{{#set: reconstruction category=annotation}}
−
{{#set: smiles=C(C5(OC(OC1(C(C(C(C([O-])=O)OC1OC4(C=C3(C(C(C=C(C2(=CC=C(C(=C2)O)O))O3)=O)=C(C=4)O)))O)O))C(C(C5O)O)O))([O-])=O}}
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
−
{{#set: inchi key=InChIKey=PBBVWJQPAZYQDB-DBFWEQBMSA-L}}
+
{{#set: reconstruction tool=pathwaytools}}
−
{{#set: common name=luteolin 7-O-β-D-diglucuronide}}
+
−
{{#set: molecular weight=636.476    }}
+
−
{{#set: common name=luteolin 7-O-[β-D-glucosyluronate-(1->2)-β-D-glucuronide]}}
+
−
{{#set: consumed by=RXN-15288}}
+

Latest revision as of 19:01, 21 March 2018

Reaction RXN-11245

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • 3-hydroxyacyl-CoA dehydrogenase
    • 6-phosphogluconate dehydrogenase, C-terminal-like
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 NAD+[c] + 1 3S-(4-hydroxyphenyl)-3-hydroxy-propanoyl-CoA[c] => 1 NADH[c] + 1 H+[c] + 1 4-hydroxybenzoyl-acetyl-CoA[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-6435, 4-hydroxybenzoate biosynthesis V: PWY-6435
    • 3 reactions found over 5 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=RXN-11245&oldid=23843"