Difference between revisions of "CPD-18085"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=2.7.1.148-RXN 2.7.1.148-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** GHMP kinase N-termi...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18085 CPD-18085] == * smiles: ** C5(N(C1(OC(C(C1O)O)COP(OP(OCC4(C(C(C(N3(C2(=C(C(=NC=N2)N)N...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=2.7.1.148-RXN 2.7.1.148-RXN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18085 CPD-18085] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C5(N(C1(OC(C(C1O)O)COP(OP(OCC4(C(C(C(N3(C2(=C(C(=NC=N2)N)N=C3)))O4)OP([O-])([O-])=O)O))([O-])=O)(=O)[O-]))CC(=CC=5)C(=O)N)
 +
* inchi key:
 +
** InChIKey=SNZSFAQYVLPEBZ-NNYOXOHSSA-J
 
* common name:
 
* common name:
−
** GHMP kinase N-terminal domain
+
** 1,2-dihydro-β-NADP
−
* ec number:
+
* molecular weight:
−
** [http://enzyme.expasy.org/EC/2.7.1.148 EC-2.7.1.148]
+
** 741.394   
 
* Synonym(s):
 
* Synonym(s):
 +
** 2-dihydro-nicotinamide adenine dinucleotide phosphate
 +
** 2DHNADP
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[ATP]][c] '''+''' 1 [[4-CYTIDINE-5-DIPHOSPHO-2-C]][c] '''=>''' 1 [[ADP]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[2-PHOSPHO-4-CYTIDINE-5-DIPHOSPHO-2-C-MET]][c]
+
* [[RXN-16765]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 ATP[c] '''+''' 1 4-(cytidine 5'-diphospho)-2-C-methyl-D-erythritol[c] '''=>''' 1 ADP[c] '''+''' 1 H+[c] '''+''' 1 2-phospho-4-(cytidine 5'-diphospho)-2-C-methyl-D-erythritol[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Ec-10_001370]]
+
−
** ESILICULOSUS_GENOME
+
−
***EC-NUMBER
+
−
** [[pantograph]]-[[aragem]]
+
−
== Pathways  ==
+
−
* [[NONMEVIPP-PWY]], methylerythritol phosphate pathway I: [http://metacyc.org/META/NEW-IMAGE?object=NONMEVIPP-PWY NONMEVIPP-PWY]
+
−
** '''8''' reactions found over '''9''' reactions in the full pathway
+
−
* [[PWY-7560]], methylerythritol phosphate pathway II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7560 PWY-7560]
+
−
** '''9''' reactions found over '''9''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[aragem]]
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[esiliculosus_genome]]
+
 
== External links  ==
 
== External links  ==
−
* RHEA:
+
{{#set: smiles=C5(N(C1(OC(C(C1O)O)COP(OP(OCC4(C(C(C(N3(C2(=C(C(=NC=N2)N)N=C3)))O4)OP([O-])([O-])=O)O))([O-])=O)(=O)[O-]))CC(=CC=5)C(=O)N)}}
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=18437 18437]
+
{{#set: inchi key=InChIKey=SNZSFAQYVLPEBZ-NNYOXOHSSA-J}}
−
* LIGAND-RXN:
+
{{#set: common name=1,2-dihydro-β-NADP}}
−
** [http://www.genome.jp/dbget-bin/www_bget?R05634 R05634]
+
{{#set: molecular weight=741.394    }}
−
{{#set: direction=LEFT-TO-RIGHT}}
+
{{#set: common name=2-dihydro-nicotinamide adenine dinucleotide phosphate|2DHNADP}}
−
{{#set: common name=GHMP kinase N-terminal domain}}
+
{{#set: produced by=RXN-16765}}
−
{{#set: ec number=EC-2.7.1.148}}
+
−
{{#set: gene associated=Ec-10_001370}}
+
−
{{#set: in pathway=NONMEVIPP-PWY|PWY-7560}}
+
−
{{#set: reconstruction category=orthology}}
+
−
{{#set: reconstruction tool=pantograph}}
+
−
{{#set: reconstruction source=aragem}}
+
−
{{#set: reconstruction category=annotation}}
+
−
{{#set: reconstruction tool=pathwaytools}}
+
−
{{#set: reconstruction source=esiliculosus_genome}}
+

Latest revision as of 19:01, 21 March 2018

Metabolite CPD-18085

  • smiles:
    • C5(N(C1(OC(C(C1O)O)COP(OP(OCC4(C(C(C(N3(C2(=C(C(=NC=N2)N)N=C3)))O4)OP([O-])([O-])=O)O))([O-])=O)(=O)[O-]))CC(=CC=5)C(=O)N)
  • inchi key:
    • InChIKey=SNZSFAQYVLPEBZ-NNYOXOHSSA-J
  • common name:
    • 1,2-dihydro-β-NADP
  • molecular weight:
    • 741.394
  • Synonym(s):
    • 2-dihydro-nicotinamide adenine dinucleotide phosphate
    • 2DHNADP

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C5(N(C1(OC(C(C1O)O)COP(OP(OCC4(C(C(C(N3(C2(=C(C(=NC=N2)N)N=C3)))O4)OP([O-])([O-])=O)O))([O-])=O)(=O)[O-]))CC(=CC=5)C(=O)N)" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=CPD-18085&oldid=23912"