Difference between revisions of "CPD-7139"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=BIOTINLIG-RXN BIOTINLIG-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** Biotin/lipoate A/B...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7139 CPD-7139] == * smiles: ** C(O)C1(C(O)C(O)C(O)C(O1)OC5(C4(C=C(OC2(C(O)C(O)C(O)C(CO)O2))...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=BIOTINLIG-RXN BIOTINLIG-RXN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7139 CPD-7139] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C(O)C1(C(O)C(O)C(O)C(O1)OC5(C4(C=C(OC2(C(O)C(O)C(O)C(CO)O2))C(C3(C=C(O)C(O)=C(O)C=3))=[O+]C=4C=C([O-])C=5)))
 +
* inchi key:
 +
** InChIKey=XCTGXGVGJYACEI-LCENJUANSA-N
 
* common name:
 
* common name:
−
** Biotin/lipoate A/B protein ligase
+
** delphinidin 3,5-di-O-β-D-glucoside
−
** Biotin/lipoate A/B protein ligase family
+
* molecular weight:
−
** biotin-[acetyl-CoA-carboxylase] ligase
+
** 626.524   
−
* ec number:
+
−
** [http://enzyme.expasy.org/EC/6.3.4.15 EC-6.3.4.15]
+
 
* Synonym(s):
 
* Synonym(s):
 +
** delphinidin-3,5-diglucoside
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[BCCP-monomers]][c] '''+''' 1 [[ATP]][c] '''+''' 1 [[BIOTIN]][c] '''=>''' 1 [[PROTON]][c] '''+''' 1 [[AMP]][c] '''+''' 1 [[PPI]][c] '''+''' 1 [[BCCP-biotin-monomers]][c]
+
* [[RXN-8228]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 a [biotin-carboxyl-carrier protein monomer][c] '''+''' 1 ATP[c] '''+''' 1 biotin[c] '''=>''' 1 H+[c] '''+''' 1 AMP[c] '''+''' 1 diphosphate[c] '''+''' 1 a biotinylated [BCCP monomer][c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Ec-00_003530]]
+
−
** ESILICULOSUS_GENOME
+
−
***GO-TERM
+
−
* [[Ec-05_005190]]
+
−
** ESILICULOSUS_GENOME
+
−
***AUTOMATED-NAME-MATCH
+
−
* [[Ec-01_008620]]
+
−
** ESILICULOSUS_GENOME
+
−
***AUTOMATED-NAME-MATCH
+
−
* [[Ec-11_004970]]
+
−
** ESILICULOSUS_GENOME
+
−
***AUTOMATED-NAME-MATCH
+
−
== Pathways  ==
+
−
* [[PWY0-1264]], biotin-carboxyl carrier protein assembly: [http://metacyc.org/META/NEW-IMAGE?object=PWY0-1264 PWY0-1264]
+
−
** '''3''' reactions found over '''4''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[esiliculosus_genome]]
+
 
== External links  ==
 
== External links  ==
−
* UNIPROT:
+
* PUBCHEM:
−
** [http://www.uniprot.org/uniprot/P06709 P06709]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25201902 25201902]
−
** [http://www.uniprot.org/uniprot/Q9PJ27 Q9PJ27]
+
* CHEBI:
−
** [http://www.uniprot.org/uniprot/Q9CEQ6 Q9CEQ6]
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=77838 77838]
−
** [http://www.uniprot.org/uniprot/Q9CED9 Q9CED9]
+
* LIGAND-CPD:
−
** [http://www.uniprot.org/uniprot/Q9JWI7 Q9JWI7]
+
** [http://www.genome.jp/dbget-bin/www_bget?C16312 C16312]
−
** [http://www.uniprot.org/uniprot/P48445 P48445]
+
* HMDB : HMDB30693
−
** [http://www.uniprot.org/uniprot/P72816 P72816]
+
{{#set: smiles=C(O)C1(C(O)C(O)C(O)C(O1)OC5(C4(C=C(OC2(C(O)C(O)C(O)C(CO)O2))C(C3(C=C(O)C(O)=C(O)C=3))=[O+]C=4C=C([O-])C=5)))}}
−
{{#set: direction=LEFT-TO-RIGHT}}
+
{{#set: inchi key=InChIKey=XCTGXGVGJYACEI-LCENJUANSA-N}}
−
{{#set: common name=Biotin/lipoate A/B protein ligase}}
+
{{#set: common name=delphinidin 3,5-di-O-β-D-glucoside}}
−
{{#set: common name=Biotin/lipoate A/B protein ligase family}}
+
{{#set: molecular weight=626.524    }}
−
{{#set: common name=biotin-[acetyl-CoA-carboxylase] ligase}}
+
{{#set: common name=delphinidin-3,5-diglucoside}}
−
{{#set: ec number=EC-6.3.4.15}}
+
{{#set: produced by=RXN-8228}}
−
{{#set: gene associated=Ec-00_003530|Ec-05_005190|Ec-01_008620|Ec-11_004970}}
+
−
{{#set: in pathway=PWY0-1264}}
+
−
{{#set: reconstruction category=annotation}}
+
−
{{#set: reconstruction tool=pathwaytools}}
+
−
{{#set: reconstruction source=esiliculosus_genome}}
+

Latest revision as of 19:01, 21 March 2018

Metabolite CPD-7139

  • smiles:
    • C(O)C1(C(O)C(O)C(O)C(O1)OC5(C4(C=C(OC2(C(O)C(O)C(O)C(CO)O2))C(C3(C=C(O)C(O)=C(O)C=3))=[O+]C=4C=C([O-])C=5)))
  • inchi key:
    • InChIKey=XCTGXGVGJYACEI-LCENJUANSA-N
  • common name:
    • delphinidin 3,5-di-O-β-D-glucoside
  • molecular weight:
    • 626.524
  • Synonym(s):
    • delphinidin-3,5-diglucoside

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(O)C1(C(O)C(O)C(O)C(O1)OC5(C4(C=C(OC2(C(O)C(O)C(O)C(CO)O2))C(C3(C=C(O)C(O)=C(O)C=3))=[O+]C=4C=C([O-])C=5)))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=CPD-7139&oldid=23915"