Difference between revisions of "Ec-06 000280"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4581 CPD-4581] == * smiles: ** CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(CC(=O)CCC(C)1C=2CCC(C)...")
 
(Created page with "Category:Gene == Gene Ec-06_000280 == * left end position: ** 205108 * transcription direction: ** NEGATIVE * right end position: ** 205986 * centisome position: ** 2.3420...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4581 CPD-4581] ==
+
== Gene Ec-06_000280 ==
−
* smiles:
+
* left end position:
−
** CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(CC(=O)CCC(C)1C=2CCC(C)34))))
+
** 205108
−
* inchi key:
+
* transcription direction:
−
** InChIKey=AUNLIRXIJAVBNM-ZSBATXSLSA-N
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** 5α-cholesta-8,24-dien-3-one
+
** 205986
−
* molecular weight:
+
* centisome position:
−
** 382.628    
+
** 2.342015    
 
* Synonym(s):
 
* Synonym(s):
 +
** Esi_0085_0088
 +
** Esi0085_0088
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[DNA-DIRECTED-RNA-POLYMERASE-RXN]]
−
* [[RXN66-318]]
+
** Source: [[annotation-esiliculosus_genome]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: go-term
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=205108}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=22298942 22298942]
+
{{#set: transcription direction=NEGATIVE}}
−
* CHEBI:
+
{{#set: right end position=205986}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=52386 52386]
+
{{#set: centisome position=2.342015    }}
−
{{#set: smiles=CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(CC(=O)CCC(C)1C=2CCC(C)34))))}}
+
{{#set: common name=Esi_0085_0088|Esi0085_0088}}
−
{{#set: inchi key=InChIKey=AUNLIRXIJAVBNM-ZSBATXSLSA-N}}
+
{{#set: reaction associated=DNA-DIRECTED-RNA-POLYMERASE-RXN}}
−
{{#set: common name=5α-cholesta-8,24-dien-3-one}}
+
−
{{#set: molecular weight=382.628    }}
+
−
{{#set: produced by=RXN66-318}}
+

Latest revision as of 19:01, 21 March 2018

Gene Ec-06_000280

  • left end position:
    • 205108
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 205986
  • centisome position:
    • 2.342015
  • Synonym(s):
    • Esi_0085_0088
    • Esi0085_0088

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-06_000280&oldid=23920"