Difference between revisions of "PWY-3722"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-248 CPD-248] == * smiles: ** C(C1(C(=CC=CC=1)NC=O))=O * inchi key: ** InChIKey=PVIMSPYDDGDC...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-3722 PWY-3722] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1239 TAX-12...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-248 CPD-248] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-3722 PWY-3722] ==
* smiles:
+
* taxonomic range:
** C(C1(C(=CC=CC=1)NC=O))=O
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1239 TAX-1239]
* inchi key:
+
** InChIKey=PVIMSPYDDGDCTG-UHFFFAOYSA-N
+
 
* common name:
 
* common name:
** 2-formylaminobenzaldehyde
+
** glycine betaine biosynthesis II (Gram-positive bacteria)
* molecular weight:
+
** 149.149   
+
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
== Reaction(s) known to produce the compound ==
+
'''1''' reactions found over '''2''' reactions in the full pathway
* [[INDOLE-23-DIOXYGENASE-RXN]]
+
* [[BADH-RXN]]
== Reaction(s) of unknown directionality ==
+
** 1 associated gene(s):
 +
*** [[Ec-20_003790]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-aragem]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-6021 RXN-6021]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: taxonomic range=TAX-1239}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=400 400]
+
{{#set: common name=glycine betaine biosynthesis II (Gram-positive bacteria)}}
* CHEMSPIDER:
+
{{#set: reaction found=1}}
** [http://www.chemspider.com/Chemical-Structure.389.html 389]
+
{{#set: total reaction=2}}
* CHEBI:
+
{{#set: completion rate=50.0}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=18033 18033]
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C03574 C03574]
+
{{#set: smiles=C(C1(C(=CC=CC=1)NC=O))=O}}
+
{{#set: inchi key=InChIKey=PVIMSPYDDGDCTG-UHFFFAOYSA-N}}
+
{{#set: common name=2-formylaminobenzaldehyde}}
+
{{#set: molecular weight=149.149    }}
+
{{#set: produced by=INDOLE-23-DIOXYGENASE-RXN}}
+

Latest revision as of 19:01, 21 March 2018

Pathway PWY-3722

  • taxonomic range:
  • common name:
    • glycine betaine biosynthesis II (Gram-positive bacteria)
  • Synonym(s):

Reaction(s) found

1 reactions found over 2 reactions in the full pathway

Reaction(s) not found

External links