Difference between revisions of "CPD1F-115"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-06_009680 == * left end position: ** 7474379 * transcription direction: ** POSITIVE * right end position: ** 7483429 * centisome position: ** 85.3...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-115 CPD1F-115] == * smiles: ** CC(=CCCC(=CC=CC(=CC=CC(=CC=CC=C(C=CC=C(C=CC1(C(CCC=C1C)(C)...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-115 CPD1F-115] == |
| − | * | + | * smiles: |
| − | ** | + | ** CC(=CCCC(=CC=CC(=CC=CC(=CC=CC=C(C=CC=C(C=CC1(C(CCC=C1C)(C)C))C)C)C)C)C)C |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=WGIYGODPCLMGQH-GOXCNPTKSA-N |
| − | * | + | * common name: |
| − | ** | + | ** δ-carotene |
| − | * | + | * molecular weight: |
| − | ** | + | ** 536.882 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** ε,ψ-carotene |
| − | + | ||
| − | + | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[RXN-8028]] |
| − | * | + | * [[RXN1F-148]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | == | + | == Reaction(s) of unknown directionality == |
| + | * [[RXN1F-147]] | ||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5281230 5281230] |
| − | {{#set: | + | * CHEMSPIDER: |
| − | {{#set: | + | ** [http://www.chemspider.com/Chemical-Structure.4444642.html 4444642] |
| − | {{#set: common name= | + | * CHEBI: |
| − | {{#set: reaction associated= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=27705 27705] |
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C08586 C08586] | ||
| + | * HMDB : HMDB36925 | ||
| + | {{#set: smiles=CC(=CCCC(=CC=CC(=CC=CC(=CC=CC=C(C=CC=C(C=CC1(C(CCC=C1C)(C)C))C)C)C)C)C)C}} | ||
| + | {{#set: inchi key=InChIKey=WGIYGODPCLMGQH-GOXCNPTKSA-N}} | ||
| + | {{#set: common name=δ-carotene}} | ||
| + | {{#set: molecular weight=536.882 }} | ||
| + | {{#set: common name=ε,ψ-carotene}} | ||
| + | {{#set: consumed by=RXN-8028|RXN1F-148}} | ||
| + | {{#set: reversible reaction associated=RXN1F-147}} | ||
Latest revision as of 19:01, 21 March 2018
Contents
Metabolite CPD1F-115
- smiles:
- CC(=CCCC(=CC=CC(=CC=CC(=CC=CC=C(C=CC=C(C=CC1(C(CCC=C1C)(C)C))C)C)C)C)C)C
- inchi key:
- InChIKey=WGIYGODPCLMGQH-GOXCNPTKSA-N
- common name:
- δ-carotene
- molecular weight:
- 536.882
- Synonym(s):
- ε,ψ-carotene
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
