Difference between revisions of "Ec-21 001360"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=XANTHOSINE XANTHOSINE] == * smiles: ** C(O)C1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC(=O)NC=23))) * inchi...") |
(Created page with "Category:Gene == Gene Ec-21_001360 == * left end position: ** 2248103 * transcription direction: ** POSITIVE * right end position: ** 2261744 * centisome position: ** 30.4...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-21_001360 == |
− | * | + | * left end position: |
− | ** | + | ** 2248103 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 2261744 |
− | * | + | * centisome position: |
− | ** | + | ** 30.461609 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0025_0111 |
+ | ** Esi0025_0111 | ||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[4.2.2.10-RXN]] | |
− | * [[ | + | ** Source: [[annotation-esiliculosus_genome]] |
− | == | + | *** Assignment: automated-name-match |
+ | * Reaction: [[RXN-14897]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Assignment: automated-name-match | ||
+ | == Pathways associated == | ||
+ | * [[PWY-7243]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=2248103}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=2261744}} | |
− | + | {{#set: centisome position=30.461609 }} | |
− | + | {{#set: common name=Esi_0025_0111|Esi0025_0111}} | |
− | + | {{#set: reaction associated=4.2.2.10-RXN|RXN-14897}} | |
− | + | {{#set: pathway associated=PWY-7243}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + |
Latest revision as of 19:01, 21 March 2018
Gene Ec-21_001360
- left end position:
- 2248103
- transcription direction:
- POSITIVE
- right end position:
- 2261744
- centisome position:
- 30.461609
- Synonym(s):
- Esi_0025_0111
- Esi0025_0111
Reactions associated
- Reaction: 4.2.2.10-RXN
- Source: annotation-esiliculosus_genome
- Assignment: automated-name-match
- Source: annotation-esiliculosus_genome
- Reaction: RXN-14897
- Source: annotation-esiliculosus_genome
- Assignment: automated-name-match
- Source: annotation-esiliculosus_genome