Difference between revisions of "CANAVANINE"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-01_011640 == * left end position: ** 9724472 * transcription direction: ** POSITIVE * right end position: ** 9733524 * centisome position: ** 94.2...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CANAVANINE CANAVANINE] == * smiles: ** C(CC([N+])C(=O)[O-])ONC(=[N+])N * inchi key: ** InChIKey...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CANAVANINE CANAVANINE] == |
− | * | + | * smiles: |
− | ** | + | ** C(CC([N+])C(=O)[O-])ONC(=[N+])N |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=FSBIGDSBMBYOPN-VKHMYHEASA-O |
− | * | + | * common name: |
− | ** | + | ** L-canavanine |
− | * | + | * molecular weight: |
− | ** | + | ** 177.183 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** canavanine |
− | ** | + | ** 2-amino-4-(guanidinooxy)butyrate |
+ | ** 2-amino-4-(guanidinooxy)butyric acid | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * | + | * [[RXN-34]] |
− | * | + | == Reaction(s) known to produce the compound == |
− | + | * [[RXN-22]] | |
− | == | + | == Reaction(s) of unknown directionality == |
== External links == | == External links == | ||
− | {{#set: | + | * CAS : 543-38-4 |
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=36688185 36688185] |
− | {{#set: | + | * CHEBI: |
− | {{#set: common name= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=78902 78902] |
− | {{#set: | + | * LIGAND-CPD: |
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C00308 C00308] | ||
+ | * HMDB : HMDB02706 | ||
+ | {{#set: smiles=C(CC([N+])C(=O)[O-])ONC(=[N+])N}} | ||
+ | {{#set: inchi key=InChIKey=FSBIGDSBMBYOPN-VKHMYHEASA-O}} | ||
+ | {{#set: common name=L-canavanine}} | ||
+ | {{#set: molecular weight=177.183 }} | ||
+ | {{#set: common name=canavanine|2-amino-4-(guanidinooxy)butyrate|2-amino-4-(guanidinooxy)butyric acid}} | ||
+ | {{#set: consumed by=RXN-34}} | ||
+ | {{#set: produced by=RXN-22}} |
Latest revision as of 19:01, 21 March 2018
Contents
Metabolite CANAVANINE
- smiles:
- C(CC([N+])C(=O)[O-])ONC(=[N+])N
- inchi key:
- InChIKey=FSBIGDSBMBYOPN-VKHMYHEASA-O
- common name:
- L-canavanine
- molecular weight:
- 177.183
- Synonym(s):
- canavanine
- 2-amino-4-(guanidinooxy)butyrate
- 2-amino-4-(guanidinooxy)butyric acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(CC([N+])C(=O)[O-])ONC(=[N+])N" cannot be used as a page name in this wiki.