Difference between revisions of "CARBAMOYL-P"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLUCOSAMINYL-14-ETCETERA-MANNOSYL-R GLUCOSAMINYL-14-ETCETERA-MANNOSYL-R] == * common name: ** N...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CARBAMOYL-P CARBAMOYL-P] == * smiles: ** C(=O)(N)OP(=O)([O-])[O-] * inchi key: ** InChIKey=FFQK...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CARBAMOYL-P CARBAMOYL-P] == |
+ | * smiles: | ||
+ | ** C(=O)(N)OP(=O)([O-])[O-] | ||
+ | * inchi key: | ||
+ | ** InChIKey=FFQKYPRQEYGKAF-UHFFFAOYSA-L | ||
* common name: | * common name: | ||
− | ** | + | ** carbamoyl phosphate |
+ | * molecular weight: | ||
+ | ** 139.004 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** carbamoyl-P | ||
+ | ** carbamyl-phosphate | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN-17753]] | ||
+ | * [[RXN-9]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[CARBPSYN-RXN]] | ||
+ | * [[RXN-14196]] | ||
+ | * [[RXN-13202]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | * [[RXN- | + | * [[RXN-13482]] |
+ | * [[ASPCARBTRANS-RXN]] | ||
+ | * [[ORNCARBAMTRANSFER-RXN]] | ||
+ | * [[CARBAMATE-KINASE-RXN]] | ||
== External links == | == External links == | ||
− | + | * CAS : 590-55-6 | |
− | {{#set: reversible reaction associated=RXN- | + | * METABOLIGHTS : MTBLC58228 |
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=3423467 3423467] | ||
+ | * HMDB : HMDB01096 | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C00169 C00169] | ||
+ | * CHEMSPIDER: | ||
+ | ** [http://www.chemspider.com/Chemical-Structure.2666990.html 2666990] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58228 58228] | ||
+ | * BIGG : cbp | ||
+ | {{#set: smiles=C(=O)(N)OP(=O)([O-])[O-]}} | ||
+ | {{#set: inchi key=InChIKey=FFQKYPRQEYGKAF-UHFFFAOYSA-L}} | ||
+ | {{#set: common name=carbamoyl phosphate}} | ||
+ | {{#set: molecular weight=139.004 }} | ||
+ | {{#set: common name=carbamoyl-P|carbamyl-phosphate}} | ||
+ | {{#set: consumed by=RXN-17753|RXN-9}} | ||
+ | {{#set: produced by=CARBPSYN-RXN|RXN-14196|RXN-13202}} | ||
+ | {{#set: reversible reaction associated=RXN-13482|ASPCARBTRANS-RXN|ORNCARBAMTRANSFER-RXN|CARBAMATE-KINASE-RXN}} |
Latest revision as of 20:01, 21 March 2018
Contents
Metabolite CARBAMOYL-P
- smiles:
- C(=O)(N)OP(=O)([O-])[O-]
- inchi key:
- InChIKey=FFQKYPRQEYGKAF-UHFFFAOYSA-L
- common name:
- carbamoyl phosphate
- molecular weight:
- 139.004
- Synonym(s):
- carbamoyl-P
- carbamyl-phosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 590-55-6
- METABOLIGHTS : MTBLC58228
- PUBCHEM:
- HMDB : HMDB01096
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- BIGG : cbp
"C(=O)(N)OP(=O)([O-])[O-" cannot be used as a page name in this wiki.