Difference between revisions of "CPD-19160"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15619 CPD-15619] == * smiles: ** CC(C(O)C(O)C([CH]=O)O)O * inchi key: ** InChIKey=PNNNRSAQS...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19160 CPD-19160] == * smiles: ** CCCCCCC=CCCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19160 CPD-19160] == |
* smiles: | * smiles: | ||
| − | ** CC(C(O)C(O)C([ | + | ** CCCCCCC=CCCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=OUROWZUTGFHRJE-SAIINBSPSA-J |
* common name: | * common name: | ||
| − | ** | + | ** 3-oxo-(11Z)-octadecenoyl-CoA |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 1041.936 |
* Synonym(s): | * Synonym(s): | ||
| + | ** 3-oxo-18:1-Δ11-CoA | ||
| + | ** 3-oxo-11-cis-octadecenoyl-CoA | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-17786]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | |||
== External links == | == External links == | ||
| − | + | {{#set: smiles=CCCCCCC=CCCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} | |
| − | + | {{#set: inchi key=InChIKey=OUROWZUTGFHRJE-SAIINBSPSA-J}} | |
| − | + | {{#set: common name=3-oxo-(11Z)-octadecenoyl-CoA}} | |
| − | + | {{#set: molecular weight=1041.936 }} | |
| − | {{#set: smiles=CC(C(O)C(O)C([ | + | {{#set: common name=3-oxo-18:1-Δ11-CoA|3-oxo-11-cis-octadecenoyl-CoA}} |
| − | {{#set: inchi key=InChIKey= | + | {{#set: produced by=RXN-17786}} |
| − | {{#set: common name= | + | |
| − | {{#set: molecular weight= | + | |
| − | {{#set: | + | |
Latest revision as of 19:02, 21 March 2018
Contents
Metabolite CPD-19160
- smiles:
- CCCCCCC=CCCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
- inchi key:
- InChIKey=OUROWZUTGFHRJE-SAIINBSPSA-J
- common name:
- 3-oxo-(11Z)-octadecenoyl-CoA
- molecular weight:
- 1041.936
- Synonym(s):
- 3-oxo-18:1-Δ11-CoA
- 3-oxo-11-cis-octadecenoyl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCCCCCC=CCCCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.
