Difference between revisions of "CPD-700"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-700 CPD-700] == * smiles: ** CC(C)C(=C)CCC(C)[CH]3(CC[CH]4(C2(=CC=C1(CC(O)CCC(C)1[CH]2CCC(C...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Pathway]]
+
[[Category:Metabolite]]
−
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-4381 PWY-4381] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-700 CPD-700] ==
−
* taxonomic range:
+
* smiles:
−
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759]
+
** CC(C)C(=C)CCC(C)[CH]3(CC[CH]4(C2(=CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))
−
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
+
* inchi key:
 +
** InChIKey=ZEPNVCGPJXYABB-LOIOQLKMSA-N
 
* common name:
 
* common name:
−
** fatty acid biosynthesis initiation I
+
** ergosta-5,7,24(28)-trien-3β-ol
 +
* molecular weight:
 +
** 396.655   
 
* Synonym(s):
 
* Synonym(s):
−
** de novo fatty acid biosynthesis, initial reactions
+
** 5,7,24(28)-ergostatrienol
 +
** 5-dehydro episterol
  
−
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
−
'''2''' reactions found over '''3''' reactions in the full pathway
+
* [[RXN-707]]
−
* [[ACETYL-COA-CARBOXYLTRANSFER-RXN]]
+
== Reaction(s) known to produce the compound ==
−
* [[MALONYL-COA-ACP-TRANSACYL-RXN]]
+
* [[RXN3O-218]]
−
== Reaction(s) not found ==
+
== Reaction(s) of unknown directionality ==
−
* [http://metacyc.org/META/NEW-IMAGE?object=2.3.1.180-RXN 2.3.1.180-RXN]
+
 
== External links  ==
 
== External links  ==
−
* ECOCYC:
+
* LIGAND-CPD:
−
** [http://metacyc.org/ECOLI/NEW-IMAGE?object=PWY-4381 PWY-4381]
+
** [http://www.genome.jp/dbget-bin/www_bget?C15780 C15780]
−
* ARACYC:
+
* HMDB : HMDB06848
−
** [http://metacyc.org/ARA/NEW-IMAGE?object=PWY-4381 PWY-4381]
+
* CHEBI:
−
{{#set: taxonomic range=TAX-2759}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=52972 52972]
−
{{#set: taxonomic range=TAX-2}}
+
* PUBCHEM:
−
{{#set: common name=fatty acid biosynthesis initiation I}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=10894570 10894570]
−
{{#set: common name=de novo fatty acid biosynthesis, initial reactions}}
+
{{#set: smiles=CC(C)C(=C)CCC(C)[CH]3(CC[CH]4(C2(=CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))}}
−
{{#set: reaction found=2}}
+
{{#set: inchi key=InChIKey=ZEPNVCGPJXYABB-LOIOQLKMSA-N}}
−
{{#set: reaction not found=3}}
+
{{#set: common name=ergosta-5,7,24(28)-trien-3β-ol}}
−
{{#set: completion rate=67.0}}
+
{{#set: molecular weight=396.655    }}
 +
{{#set: common name=5,7,24(28)-ergostatrienol|5-dehydro episterol}}
 +
{{#set: consumed by=RXN-707}}
 +
{{#set: produced by=RXN3O-218}}

Latest revision as of 19:02, 21 March 2018

Metabolite CPD-700

  • smiles:
    • CC(C)C(=C)CCC(C)[CH]3(CC[CH]4(C2(=CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))
  • inchi key:
    • InChIKey=ZEPNVCGPJXYABB-LOIOQLKMSA-N
  • common name:
    • ergosta-5,7,24(28)-trien-3β-ol
  • molecular weight:
    • 396.655
  • Synonym(s):
    • 5,7,24(28)-ergostatrienol
    • 5-dehydro episterol

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)C(=C)CCC(C)[CH]3(CC[CH]4(C2(=CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=CPD-700&oldid=24018"