Difference between revisions of "Ec-08 006680"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CANAVANINE CANAVANINE] == * smiles: ** C(CC([N+])C(=O)[O-])ONC(=[N+])N * inchi key: ** InChIKey...")
(Created page with "Category:Gene == Gene Ec-08_006680 == * left end position: ** 6664423 * transcription direction: ** NEGATIVE * right end position: ** 6672482 * centisome position: ** 99.5...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CANAVANINE CANAVANINE] ==
+
== Gene Ec-08_006680 ==
−
* smiles:
+
* left end position:
−
** C(CC([N+])C(=O)[O-])ONC(=[N+])N
+
** 6664423
−
* inchi key:
+
* transcription direction:
−
** InChIKey=FSBIGDSBMBYOPN-VKHMYHEASA-O
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** L-canavanine
+
** 6672482
−
* molecular weight:
+
* centisome position:
−
** 177.183    
+
** 99.51257    
 
* Synonym(s):
 
* Synonym(s):
−
** canavanine
+
** Esi_0005_0005
−
** 2-amino-4-(guanidinooxy)butyrate
+
** Esi0005_0005
−
** 2-amino-4-(guanidinooxy)butyric acid
+
** MAPK
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-34]]
+
* Reaction: [[2.7.11.24-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-esiliculosus_genome]]
−
* [[RXN-22]]
+
*** Assignment: go-term
−
== Reaction(s) of unknown directionality ==
+
* Reaction: [[RXN-8443]]
 +
** Source: [[orthology-aragem]]
 +
== Pathways associated ==
 +
* [[PWY-5381]]
 
== External links  ==
 
== External links  ==
−
* CAS : 543-38-4
+
{{#set: left end position=6664423}}
−
* PUBCHEM:
+
{{#set: transcription direction=NEGATIVE}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=36688185 36688185]
+
{{#set: right end position=6672482}}
−
* CHEBI:
+
{{#set: centisome position=99.51257   }}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=78902 78902]
+
{{#set: common name=Esi_0005_0005|Esi0005_0005|MAPK}}
−
* LIGAND-CPD:
+
{{#set: reaction associated=2.7.11.24-RXN|RXN-8443}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00308 C00308]
+
{{#set: pathway associated=PWY-5381}}
−
* HMDB : HMDB02706
+
−
{{#set: smiles=C(CC([N+])C(=O)[O-])ONC(=[N+])N}}
+
−
{{#set: inchi key=InChIKey=FSBIGDSBMBYOPN-VKHMYHEASA-O}}
+
−
{{#set: common name=L-canavanine}}
+
−
{{#set: molecular weight=177.183   }}
+
−
{{#set: common name=canavanine|2-amino-4-(guanidinooxy)butyrate|2-amino-4-(guanidinooxy)butyric acid}}
+
−
{{#set: consumed by=RXN-34}}
+
−
{{#set: produced by=RXN-22}}
+

Latest revision as of 20:02, 21 March 2018

Gene Ec-08_006680

  • left end position:
    • 6664423
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 6672482
  • centisome position:
    • 99.51257
  • Synonym(s):
    • Esi_0005_0005
    • Esi0005_0005
    • MAPK

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-08_006680&oldid=24023"