Difference between revisions of "Ec-03 000880"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-3-DIHYDROXYBENZOATE 2-3-DIHYDROXYBENZOATE] == * smiles: ** C(C1(=CC=CC(=C1O)O))([O-])=O * inc...")
(Created page with "Category:Gene == Gene Ec-03_000880 == * left end position: ** 1092099 * transcription direction: ** POSITIVE * right end position: ** 1094949 * centisome position: ** 16.7...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-3-DIHYDROXYBENZOATE 2-3-DIHYDROXYBENZOATE] ==
+
== Gene Ec-03_000880 ==
−
* smiles:
+
* left end position:
−
** C(C1(=CC=CC(=C1O)O))([O-])=O
+
** 1092099
−
* inchi key:
+
* transcription direction:
−
** InChIKey=GLDQAMYCGOIJDV-UHFFFAOYSA-M
+
** POSITIVE
−
* common name:
+
* right end position:
−
** 2,3-dihydroxybenzoate
+
** 1094949
−
* molecular weight:
+
* centisome position:
−
** 153.114    
+
** 16.727764    
 
* Synonym(s):
 
* Synonym(s):
−
** 2,3-dihydroxybenzoic acid
+
** Esi_0027_0013
−
** 3-hydroxysalicylate
+
** Esi0027_0013
−
** catechol-3-carboxylate
+
−
** 2-pyrocatechuate
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[RXN-8668]]
−
* [[DHBDEHYD-RXN]]
+
** Source: [[annotation-esiliculosus_genome]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: go-term
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* CAS : 303-38-8
+
{{#set: left end position=1092099}}
−
* PUBCHEM:
+
{{#set: transcription direction=POSITIVE}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=54675818 54675818]
+
{{#set: right end position=1094949}}
−
* HMDB : HMDB00397
+
{{#set: centisome position=16.727764   }}
−
* LIGAND-CPD:
+
{{#set: common name=Esi_0027_0013|Esi0027_0013}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00196 C00196]
+
{{#set: reaction associated=RXN-8668}}
−
* CHEMSPIDER:
+
−
** [http://www.chemspider.com/Chemical-Structure.5323089.html 5323089]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=36654 36654]
+
−
* BIGG : 34227
+
−
{{#set: smiles=C(C1(=CC=CC(=C1O)O))([O-])=O}}
+
−
{{#set: inchi key=InChIKey=GLDQAMYCGOIJDV-UHFFFAOYSA-M}}
+
−
{{#set: common name=2,3-dihydroxybenzoate}}
+
−
{{#set: molecular weight=153.114   }}
+
−
{{#set: common name=2,3-dihydroxybenzoic acid|3-hydroxysalicylate|catechol-3-carboxylate|2-pyrocatechuate}}
+
−
{{#set: produced by=DHBDEHYD-RXN}}
+

Latest revision as of 19:02, 21 March 2018

Gene Ec-03_000880

  • left end position:
    • 1092099
  • transcription direction:
    • POSITIVE
  • right end position:
    • 1094949
  • centisome position:
    • 16.727764
  • Synonym(s):
    • Esi_0027_0013
    • Esi0027_0013

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-03_000880&oldid=24030"