Difference between revisions of "CPD-488"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=PYRNUTRANSHYDROGEN-RXN PYRNUTRANSHYDROGEN-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** N...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-488 CPD-488] == * smiles: ** CC1(OC(OP(=O)([O-])[O-])C(O)C(O)C(O)1) * inchi key: ** InChIKe...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-488 CPD-488] == |
− | * | + | * smiles: |
− | ** | + | ** CC1(OC(OP(=O)([O-])[O-])C(O)C(O)C(O)1) |
+ | * inchi key: | ||
+ | ** InChIKey=PTVXQARCLQPGIR-SXUWKVJYSA-L | ||
* common name: | * common name: | ||
− | ** | + | ** β-L-fucose 1-phosphate |
− | + | * molecular weight: | |
− | + | ** 242.122 | |
− | + | ||
− | * | + | |
− | ** | + | |
* Synonym(s): | * Synonym(s): | ||
+ | ** L-Fucose 1-phosphate | ||
+ | ** 6-deoxy-L-galactose 1-phosphate | ||
+ | ** L-fucopyranose 1-(dihydrogen phosphate) | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | * [[2.7.7.30-RXN]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[FUCOKINASE-RXN]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | = | + | |
− | + | ||
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | * [[ | + | |
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | * | + | * PUBCHEM: |
− | ** [http:// | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266535 45266535] |
− | * | + | * CHEBI: |
− | ** [http://www. | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57268 57268] |
− | + | * LIGAND-CPD: | |
− | + | ** [http://www.genome.jp/dbget-bin/www_bget?C02985 C02985] | |
− | + | * HMDB : HMDB01265 | |
− | * | + | {{#set: smiles=CC1(OC(OP(=O)([O-])[O-])C(O)C(O)C(O)1)}} |
− | ** [http://www. | + | {{#set: inchi key=InChIKey=PTVXQARCLQPGIR-SXUWKVJYSA-L}} |
− | * | + | {{#set: common name=β-L-fucose 1-phosphate}} |
− | + | {{#set: molecular weight=242.122 }} | |
− | + | {{#set: common name=L-Fucose 1-phosphate|6-deoxy-L-galactose 1-phosphate|L-fucopyranose 1-(dihydrogen phosphate)}} | |
− | + | {{#set: consumed by=2.7.7.30-RXN}} | |
− | + | {{#set: produced by=FUCOKINASE-RXN}} | |
− | + | ||
− | {{#set: | + | |
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | + |
Latest revision as of 19:02, 21 March 2018
Contents
Metabolite CPD-488
- smiles:
- CC1(OC(OP(=O)([O-])[O-])C(O)C(O)C(O)1)
- inchi key:
- InChIKey=PTVXQARCLQPGIR-SXUWKVJYSA-L
- common name:
- β-L-fucose 1-phosphate
- molecular weight:
- 242.122
- Synonym(s):
- L-Fucose 1-phosphate
- 6-deoxy-L-galactose 1-phosphate
- L-fucopyranose 1-(dihydrogen phosphate)
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC1(OC(OP(=O)([O-])[O-])C(O)C(O)C(O)1)" cannot be used as a page name in this wiki.