Difference between revisions of "PWY-4101"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12177 CPD-12177] == * smiles: ** CC([CH]=O)C(=O)[O-] * inchi key: ** InChIKey=VOKUMXABRRXHA...")
 
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-4101 PWY-4101] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-47...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12177 CPD-12177] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-4101 PWY-4101] ==
* smiles:
+
* taxonomic range:
** CC([CH]=O)C(=O)[O-]
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751]
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
** InChIKey=VOKUMXABRRXHAR-GSVOUGTGSA-M
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-71275 TAX-71275]
 
* common name:
 
* common name:
** (R)-methylmalonate-semialdehyde
+
** D-sorbitol degradation I
* molecular weight:
+
** 101.082   
+
 
* Synonym(s):
 
* Synonym(s):
** (R)-2-methyl-3-oxopropanoate
+
** sorbitol utilization
** (R)-ch3-malonate-semialdehyde
+
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
== Reaction(s) known to produce the compound ==
+
'''3''' reactions found over '''3''' reactions in the full pathway
== Reaction(s) of unknown directionality ==
+
* [[FRUCTOKINASE-RXN]]
* [[RXN-14056]]
+
** 1 associated gene(s):
 +
*** [[Ec-18_002990]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-aragem]]
 +
* [[RXN-14515]]
 +
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
* [[RXN-7644]]
 +
** 1 associated gene(s):
 +
*** [[Ec-18_002860]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
== Reaction(s) not found ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: taxonomic range=TAX-4751}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46173310 46173310]
+
{{#set: taxonomic range=TAX-2}}
{{#set: smiles=CC([CH]=O)C(=O)[O-]}}
+
{{#set: taxonomic range=TAX-71275}}
{{#set: inchi key=InChIKey=VOKUMXABRRXHAR-GSVOUGTGSA-M}}
+
{{#set: common name=D-sorbitol degradation I}}
{{#set: common name=(R)-methylmalonate-semialdehyde}}
+
{{#set: common name=sorbitol utilization}}
{{#set: molecular weight=101.082    }}
+
{{#set: reaction found=3}}
{{#set: common name=(R)-2-methyl-3-oxopropanoate|(R)-ch3-malonate-semialdehyde}}
+
{{#set: total reaction=3}}
{{#set: consumed or produced by=RXN-14056}}
+
{{#set: completion rate=100.0}}

Latest revision as of 19:02, 21 March 2018

Pathway PWY-4101

  • taxonomic range:
  • common name:
    • D-sorbitol degradation I
  • Synonym(s):
    • sorbitol utilization

Reaction(s) found

3 reactions found over 3 reactions in the full pathway

Reaction(s) not found

External links