Difference between revisions of "Ec-08 000930"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13122 CPD-13122] == * smiles: ** C(C1(OC(C(C(C=1)O)O)O))([O-])=O * inchi key: ** InChIKey=I...") |
(Created page with "Category:Gene == Gene Ec-08_000930 == * left end position: ** 945965 * transcription direction: ** POSITIVE * right end position: ** 954854 * centisome position: ** 14.125...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-08_000930 == |
− | * | + | * left end position: |
− | ** | + | ** 945965 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 954854 |
− | * | + | * centisome position: |
− | ** | + | ** 14.125066 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0214_0043 |
− | ** | + | ** Esi0214_0043 |
− | + | ||
− | + | ||
− | + | ||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[4.2.2.10-RXN]] | |
− | * [[ | + | ** Source: [[annotation-esiliculosus_genome]] |
− | * [[RXN- | + | *** Assignment: automated-name-match |
− | == | + | * Reaction: [[RXN-14897]] |
− | * [[ | + | ** Source: [[annotation-esiliculosus_genome]] |
+ | *** Assignment: automated-name-match | ||
+ | == Pathways associated == | ||
+ | * [[PWY-7243]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=945965}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=954854}} | |
− | + | {{#set: centisome position=14.125066 }} | |
− | {{#set: | + | {{#set: common name=Esi_0214_0043|Esi0214_0043}} |
− | {{#set: | + | {{#set: reaction associated=4.2.2.10-RXN|RXN-14897}} |
− | {{#set: | + | {{#set: pathway associated=PWY-7243}} |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 20:02, 21 March 2018
Gene Ec-08_000930
- left end position:
- 945965
- transcription direction:
- POSITIVE
- right end position:
- 954854
- centisome position:
- 14.125066
- Synonym(s):
- Esi_0214_0043
- Esi0214_0043
Reactions associated
- Reaction: 4.2.2.10-RXN
- Source: annotation-esiliculosus_genome
- Assignment: automated-name-match
- Source: annotation-esiliculosus_genome
- Reaction: RXN-14897
- Source: annotation-esiliculosus_genome
- Assignment: automated-name-match
- Source: annotation-esiliculosus_genome