Difference between revisions of "RXN-15378"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TRYPTAMINE TRYPTAMINE] == * smiles: ** C([N+])CC2(=CNC1(=C(C=CC=C1)2)) * inchi key: ** InChIKey...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15378 RXN-15378] == * direction: ** LEFT-TO-RIGHT * common name: ** Succinate dehydrogenase/fum...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TRYPTAMINE TRYPTAMINE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15378 RXN-15378] ==
−
* smiles:
+
* direction:
−
** C([N+])CC2(=CNC1(=C(C=CC=C1)2))
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=APJYDQYYACXCRM-UHFFFAOYSA-O
+
 
* common name:
 
* common name:
−
** tryptamine
+
** Succinate dehydrogenase/fumarate reductase flavoprotein, catalytic domain
−
* molecular weight:
+
** SDH4, succinate dehydrogenase subunit 4
−
** 161.226   
+
** SDH1, succinate dehydrogenase subunit 1
 +
** SDH3, succinate dehydrogenase subunit 3
 +
** SDH2, succinate dehydrogenase subunit 2
 +
* ec number:
 +
** [http://enzyme.expasy.org/EC/1.3.5.1 EC-1.3.5.1]
 
* Synonym(s):
 
* Synonym(s):
−
** 3-(2-aminoethyl)indole
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[STRICTOSIDINE-SYNTHASE-RXN]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[CPD-9612]][c] '''+''' 1 [[SUC]][c] '''=>''' 1 [[FUM]][c] '''+''' 1 [[CPD-15301]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 caldariellaquinone[c] '''+''' 1 succinate[c] '''=>''' 1 fumarate[c] '''+''' 1 caldariellaquinol[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Ec-07_007310]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Ec-11_000360]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Ec-05_003640]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: AUTOMATED-NAME-MATCH
 +
* Gene: [[Ec-27_006560]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: AUTOMATED-NAME-MATCH
 +
* Gene: [[Ec-07_002870]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Ec-21_003470]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* CAS : 61-54-1
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* PUBCHEM:
+
{{#set: common name=Succinate dehydrogenase/fumarate reductase flavoprotein, catalytic domain}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=3985862 3985862]
+
{{#set: common name=SDH4, succinate dehydrogenase subunit 4}}
−
* HMDB : HMDB00303
+
{{#set: common name=SDH1, succinate dehydrogenase subunit 1}}
−
* LIGAND-CPD:
+
{{#set: common name=SDH3, succinate dehydrogenase subunit 3}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00398 C00398]
+
{{#set: common name=SDH2, succinate dehydrogenase subunit 2}}
−
* CHEMSPIDER:
+
{{#set: ec number=EC-1.3.5.1}}
−
** [http://www.chemspider.com/Chemical-Structure.3205163.html 3205163]
+
{{#set: gene associated=Ec-07_007310|Ec-11_000360|Ec-05_003640|Ec-27_006560|Ec-07_002870|Ec-21_003470}}
−
* CHEBI:
+
{{#set: in pathway=}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57887 57887]
+
{{#set: reconstruction category=annotation}}
−
* METABOLIGHTS : MTBLC57887
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
−
{{#set: smiles=C([N+])CC2(=CNC1(=C(C=CC=C1)2))}}
+
{{#set: reconstruction tool=pathwaytools}}
−
{{#set: inchi key=InChIKey=APJYDQYYACXCRM-UHFFFAOYSA-O}}
+
−
{{#set: common name=tryptamine}}
+
−
{{#set: molecular weight=161.226    }}
+
−
{{#set: common name=3-(2-aminoethyl)indole}}
+
−
{{#set: consumed by=STRICTOSIDINE-SYNTHASE-RXN}}
+

Latest revision as of 19:02, 21 March 2018

Reaction RXN-15378

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • Succinate dehydrogenase/fumarate reductase flavoprotein, catalytic domain
    • SDH4, succinate dehydrogenase subunit 4
    • SDH1, succinate dehydrogenase subunit 1
    • SDH3, succinate dehydrogenase subunit 3
    • SDH2, succinate dehydrogenase subunit 2
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 caldariellaquinone[c] + 1 succinate[c] => 1 fumarate[c] + 1 caldariellaquinol[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=RXN-15378&oldid=24080"